Cyclothiocurvularin B
| Internal ID | a0d3cffb-eeaf-4ba0-af2f-fd91848d9442 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | (3S,4R,7S,11S)-4,17,19-trihydroxy-11-methyl-2,13-dioxo-12-oxa-6-thiatricyclo[13.4.0.03,7]nonadeca-1(15),16,18-triene-4-carboxylic acid |
| SMILES (Canonical) | CC1CCCC2C(C(=O)C3=C(CC(=O)O1)C=C(C=C3O)O)C(CS2)(C(=O)O)O |
| SMILES (Isomeric) | C[C@H]1CCC[C@H]2[C@H](C(=O)C3=C(CC(=O)O1)C=C(C=C3O)O)[C@](CS2)(C(=O)O)O |
| InChI | InChI=1S/C19H22O8S/c1-9-3-2-4-13-16(19(26,8-28-13)18(24)25)17(23)15-10(6-14(22)27-9)5-11(20)7-12(15)21/h5,7,9,13,16,20-21,26H,2-4,6,8H2,1H3,(H,24,25)/t9-,13-,16+,19+/m0/s1 |
| InChI Key | CATXBXDAUWOWMZ-JDWDLIMNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H22O8S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.10353883 g/mol |
| Topological Polar Surface Area (TPSA) | 167.00 Ų |
| XlogP | 1.80 |
| (3S,4R,7S,11S)-4,17,19-trihydroxy-11-methyl-2,13-dioxo-12-oxa-6-thiatricyclo[13.4.0.03,7]nonadeca-1(15),16,18-triene-4-carboxylic acid |
| (3S,4R,7S,11S)-4,17,19-Trihydroxy-11-methyl-2,13-dioxo-12-oxa-6-thiatricyclo(13.4.0.0,)nonadeca-1(19),15,17-triene-4-carboxylate |
| (3S,4R,7S,11S)-4,17,19-trihydroxy-11-methyl-2,13-dioxo-12-oxa-6-thiatricyclo(13.4.0.03,7)nonadeca-1(15),16,18-triene-4-carboxylic acid |
| (3S,4R,7S,11S)-4,17,19-Trihydroxy-11-methyl-2,13-dioxo-12-oxa-6-thiatricyclo[13.4.0.0,]nonadeca-1(19),15,17-triene-4-carboxylate |
| RefChem:130017 |
| CHEMBL3951023 |
| CHEBI:227758 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.36% | 96.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.23% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.13% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.88% | 91.19% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.77% | 95.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.35% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.84% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.60% | 94.45% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.75% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.63% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.51% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.55% | 89.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 84.41% | 80.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.77% | 90.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.42% | 85.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.90% | 92.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.68% | 91.07% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.25% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.47% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 134148196 |
| LOTUS | LTS0084995 |
| wikiData | Q105102079 |