Cyclosporin J
| Internal ID | d9889f69-a104-402d-8064-aa23d3441a19 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Peptoid-peptide hybrids > Cyclosporins |
| IUPAC Name | (3R,6S,9S,12R,15S,18R,21S,24S,30R,33S)-30-ethyl-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24,33-pentakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| SMILES (Canonical) | CCC1C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)CC(C)C)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| SMILES (Isomeric) | CC[C@@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@@H](C(=O)N([C@H](C(=O)N1)CC(C)C)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| InChI | InChI=1S/C59H107N11O11/c1-25-41-55(77)64(18)31-47(71)65(19)42(26-32(2)3)53(75)63-48(37(12)13)58(80)66(20)43(27-33(4)5)51(73)60-39(16)50(72)61-40(17)54(76)68(22)45(29-35(8)9)56(78)69(23)46(30-36(10)11)57(79)70(24)49(38(14)15)59(81)67(21)44(28-34(6)7)52(74)62-41/h32-46,48-49H,25-31H2,1-24H3,(H,60,73)(H,61,72)(H,62,74)(H,63,75)/t39-,40+,41+,42-,43+,44-,45-,46-,48-,49+/m0/s1 |
| InChI Key | JFJHGNWTEKJXNK-QJIKCMKMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C59H107N11O11 |
| Molecular Weight | 1146.50 g/mol |
| Exact Mass | 1145.81515327 g/mol |
| Topological Polar Surface Area (TPSA) | 259.00 Ų |
| XlogP | 7.20 |
| (3R,6S,9S,12R,15S,18R,21S,24S,30R,33S)-30-ethyl-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24,33-pentakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| RefChem:129983 |
| CHEBI:226432 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.26% | 97.25% |
| CHEMBL1949 | P62937 | Cyclophilin A | 98.88% | 98.57% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.41% | 98.95% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.42% | 93.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.89% | 96.09% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.52% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.20% | 90.08% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.43% | 98.59% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 90.85% | 92.12% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.32% | 94.66% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 89.02% | 90.93% |
| CHEMBL3869 | P50281 | Matrix metalloproteinase 14 | 88.88% | 93.10% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.39% | 94.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.37% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.54% | 90.71% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.88% | 95.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.65% | 94.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.53% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.31% | 95.56% |
| CHEMBL228 | P31645 | Serotonin transporter | 85.94% | 95.51% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.02% | 96.47% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.26% | 94.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.85% | 95.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.69% | 93.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.60% | 97.79% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.39% | 85.14% |
| CHEMBL3691 | Q13822 | Autotaxin | 82.98% | 96.39% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.08% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586679 |
| LOTUS | LTS0101129 |
| wikiData | Q77511942 |