Cyclosporin H
| Internal ID | 5044d43f-202e-4caa-a333-f342799444cd |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Peptoid-peptide hybrids > Cyclosporins |
| IUPAC Name | (3R,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| SMILES (Canonical) | CCC1C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| SMILES (Isomeric) | CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| InChI | InChI=1S/C62H111N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h25,27,34-47,49-52,75H,26,28-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50-,51+,52-/m1/s1 |
| InChI Key | PMATZTZNYRCHOR-JLPRAAIDSA-N |
| Popularity | 48 references in papers |
| Molecular Formula | C62H111N11O12 |
| Molecular Weight | 1202.60 g/mol |
| Exact Mass | 1201.84136802 g/mol |
| Topological Polar Surface Area (TPSA) | 279.00 Ų |
| XlogP | 7.50 |
| 83602-39-5 |
| Cyclosporine H |
| FUO6O3NDNH |
| (3R,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-((1R,2R,E)-1-hydroxy-2-methylhex-4-en-1-yl)-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecaone |
| Cyclosporin A, 5-(N-methyl-D-valine)- |
| Csh cyclosporin |
| (3R,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| MFCD04039488 |
| 5-(N-Methyl-D-valine)cyclosporine A |
| UNII-FUO6O3NDNH |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL6020 | O95342 | Bile salt export pump |
500 nM |
IC50 |
via Super-PRED
|
| CHEMBL1949 | P62937 | Cyclophilin A |
11 nM 9.7 nM 6.7 nM |
Kd IC50 Ki |
via Super-PRED
via Super-PRED via Super-PRED |
| CHEMBL2075 | P23284 | Cyclophilin B |
9.8 nM |
Kd |
via Super-PRED
|
| CHEMBL1697657 | Q08752 | Peptidyl-prolyl cis-trans isomerase D |
2.58 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.56% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.45% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.53% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.40% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.32% | 90.08% |
| CHEMBL4072 | P07858 | Cathepsin B | 89.74% | 93.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.94% | 90.71% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 88.77% | 92.12% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.34% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.24% | 85.14% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.46% | 96.61% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.14% | 95.71% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.93% | 90.93% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.88% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.71% | 99.23% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 84.37% | 96.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.21% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.03% | 89.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.86% | 96.47% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.86% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.54% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.49% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6476564 |
| LOTUS | LTS0075391 |
| wikiData | Q27278214 |