Cyclopiamide
| Internal ID | 3c87f69b-aef3-49a0-a9b4-6a415a31e1bd |
| Taxonomy | Organoheterocyclic compounds > Isoindoles and derivatives > Isoindolines > Isoindolones |
| IUPAC Name | 5,5,13-trimethyl-4,13-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7,9,11-pentaene-3,14-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H14N2O2/c1-16(2)9-7-8-5-4-6-10-11(8)13(15(20)18(10)3)12(9)14(19)17-16/h4-7H,1-3H3,(H,17,19) |
| InChI Key | HLFQVBSECSOJNP-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.105527694 g/mol |
| Topological Polar Surface Area (TPSA) | 49.40 Ų |
| XlogP | 1.70 |
| 126382-02-3 |
| CHEMBL4081646 |
| DTXSID90155174 |
| NSC802510 |
| NSC-802510 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.78% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.25% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.46% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.59% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.34% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.84% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.60% | 93.99% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.99% | 85.30% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.82% | 94.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.59% | 82.69% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.07% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.02% | 91.11% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.90% | 96.67% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.41% | 85.11% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.86% | 96.39% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.23% | 89.63% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.94% | 95.51% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.88% | 99.23% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.39% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 180420 |
| LOTUS | LTS0078324 |
| wikiData | Q83022936 |