cyclo[Phe-Tyr-D-Ser-D-Val-D-Pro-D-Tyr-D-Pro-Pro]
| Internal ID | c373016e-5f7e-4848-a454-db7e18a2d7b7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (3R,9R,12R,18R,21R,24S,27S,30S)-27-benzyl-21-(hydroxymethyl)-9,24-bis[(4-hydroxyphenyl)methyl]-18-propan-2-yl-1,7,10,16,19,22,25,28-octazatetracyclo[28.3.0.03,7.012,16]tritriacontane-2,8,11,17,20,23,26,29-octone |
| SMILES (Canonical) | CC(C)C1C(=O)N2CCCC2C(=O)NC(C(=O)N3CCCC3C(=O)N4CCCC4C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CO)CC5=CC=C(C=C5)O)CC6=CC=CC=C6)CC7=CC=C(C=C7)O |
| SMILES (Isomeric) | CC(C)[C@@H]1C(=O)N2CCC[C@@H]2C(=O)N[C@@H](C(=O)N3CCC[C@@H]3C(=O)N4CCC[C@H]4C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N1)CO)CC5=CC=C(C=C5)O)CC6=CC=CC=C6)CC7=CC=C(C=C7)O |
| InChI | InChI=1S/C50H62N8O11/c1-29(2)42-50(69)57-23-7-12-40(57)47(66)53-37(27-32-16-20-34(61)21-17-32)48(67)58-24-8-13-41(58)49(68)56-22-6-11-39(56)46(65)52-36(25-30-9-4-3-5-10-30)43(62)51-35(26-31-14-18-33(60)19-15-31)44(63)54-38(28-59)45(64)55-42/h3-5,9-10,14-21,29,35-42,59-61H,6-8,11-13,22-28H2,1-2H3,(H,51,62)(H,52,65)(H,53,66)(H,54,63)(H,55,64)/t35-,36-,37+,38+,39-,40+,41+,42+/m0/s1 |
| InChI Key | VGQVPZUFUDZAGA-JABIFFPESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H62N8O11 |
| Molecular Weight | 951.10 g/mol |
| Exact Mass | 950.45380482 g/mol |
| Topological Polar Surface Area (TPSA) | 267.00 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.83% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.73% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.35% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.89% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.54% | 95.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.34% | 97.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.05% | 94.45% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 92.54% | 92.97% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.19% | 90.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.52% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.31% | 91.11% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.93% | 82.38% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.30% | 91.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.64% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.40% | 97.14% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.05% | 97.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.70% | 93.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.18% | 95.83% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.09% | 95.93% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.35% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stellaria delavayi |
| PubChem | 163188534 |
| LOTUS | LTS0135387 |
| wikiData | Q105285975 |