Cyclopassifloside VII
| Internal ID | c8273617-362b-4d1f-92d5-0664303363db |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-[2,5-dihydroxy-5-(hydroxymethyl)-6-methylheptan-2-yl]-4,6,14-trihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
| SMILES (Canonical) | CC(C)C(CCC(C)(C1C(CC2(C1(CCC34C2CCC5C3(C4)C(CC(C5(C)C(=O)OC6C(C(C(C(O6)CO)O)O)O)O)O)C)C)O)O)(CO)O |
| SMILES (Isomeric) | CC(C)C(CCC(C)(C1C(CC2(C1(CCC34C2CCC5C3(C4)C(CC(C5(C)C(=O)OC6C(C(C(C(O6)CO)O)O)O)O)O)C)C)O)O)(CO)O |
| InChI | InChI=1S/C37H62O13/c1-18(2)36(48,17-39)12-10-33(5,47)28-19(40)14-32(4)21-7-8-22-34(6,30(46)50-29-27(45)26(44)25(43)20(15-38)49-29)23(41)13-24(42)37(22)16-35(21,37)11-9-31(28,32)3/h18-29,38-45,47-48H,7-17H2,1-6H3 |
| InChI Key | MOYBUGGNPKXCHY-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C37H62O13 |
| Molecular Weight | 714.90 g/mol |
| Exact Mass | 714.41904203 g/mol |
| Topological Polar Surface Area (TPSA) | 238.00 Ų |
| XlogP | 2.10 |
| Atomic LogP (AlogP) | -0.04 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 9 |
| CHEBI:168415 |
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 15-[2,5-dihydroxy-5-(hydroxymethyl)-6-methylheptan-2-yl]-4,6,14-trihydroxy-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6728 | 67.28% |
| Caco-2 | - | 0.8568 | 85.68% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.8714 | 87.14% |
| Subcellular localzation | Mitochondria | 0.7015 | 70.15% |
| OATP2B1 inhibitior | - | 0.8641 | 86.41% |
| OATP1B1 inhibitior | + | 0.8323 | 83.23% |
| OATP1B3 inhibitior | + | 0.9131 | 91.31% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.7250 | 72.50% |
| BSEP inhibitior | - | 0.7764 | 77.64% |
| P-glycoprotein inhibitior | + | 0.7309 | 73.09% |
| P-glycoprotein substrate | + | 0.5493 | 54.93% |
| CYP3A4 substrate | + | 0.7159 | 71.59% |
| CYP2C9 substrate | - | 0.8002 | 80.02% |
| CYP2D6 substrate | - | 0.8429 | 84.29% |
| CYP3A4 inhibition | - | 0.8869 | 88.69% |
| CYP2C9 inhibition | - | 0.7294 | 72.94% |
| CYP2C19 inhibition | - | 0.8000 | 80.00% |
| CYP2D6 inhibition | - | 0.9509 | 95.09% |
| CYP1A2 inhibition | - | 0.8506 | 85.06% |
| CYP2C8 inhibition | + | 0.6101 | 61.01% |
| CYP inhibitory promiscuity | - | 0.9623 | 96.23% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.7310 | 73.10% |
| Eye corrosion | - | 0.9903 | 99.03% |
| Eye irritation | - | 0.9121 | 91.21% |
| Skin irritation | - | 0.6940 | 69.40% |
| Skin corrosion | - | 0.9470 | 94.70% |
| Ames mutagenesis | - | 0.5870 | 58.70% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7013 | 70.13% |
| Micronuclear | - | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.6500 | 65.00% |
| skin sensitisation | - | 0.9091 | 90.91% |
| Respiratory toxicity | + | 0.5444 | 54.44% |
| Reproductive toxicity | + | 0.7444 | 74.44% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | - | 0.8246 | 82.46% |
| Acute Oral Toxicity (c) | I | 0.4565 | 45.65% |
| Estrogen receptor binding | + | 0.6925 | 69.25% |
| Androgen receptor binding | + | 0.7519 | 75.19% |
| Thyroid receptor binding | - | 0.5488 | 54.88% |
| Glucocorticoid receptor binding | + | 0.5890 | 58.90% |
| Aromatase binding | + | 0.6408 | 64.08% |
| PPAR gamma | + | 0.6582 | 65.82% |
| Honey bee toxicity | - | 0.6090 | 60.90% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
| Fish aquatic toxicity | + | 0.8751 | 87.51% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.76% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.94% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.83% | 96.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.25% | 85.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.24% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.96% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.76% | 96.95% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.84% | 98.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.82% | 85.14% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.26% | 99.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.99% | 98.95% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.29% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.93% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.35% | 95.93% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.64% | 96.77% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.62% | 98.75% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.08% | 96.21% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 89.18% | 95.71% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.76% | 91.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.35% | 96.47% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.94% | 96.38% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.84% | 89.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.51% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.00% | 97.14% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.60% | 97.29% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.50% | 94.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.38% | 89.34% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.26% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.32% | 89.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.00% | 95.71% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.93% | 82.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.40% | 94.00% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.71% | 97.86% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.71% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.65% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.20% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.80% | 92.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.70% | 92.86% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.17% | 93.04% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.13% | 90.93% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.86% | 91.19% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.34% | 99.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.14% | 90.08% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.12% | 92.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.46% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.33% | 98.05% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.16% | 96.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Passiflora edulis |
| PubChem | 73801616 |
| LOTUS | LTS0100263 |
| wikiData | Q105169253 |