cyclo[N(Me)Ala-bAla-D-OLeu-Pro-aMeIle-N(Me)Val]
Internal ID | e050fecd-c4d0-4985-807c-8167631da030 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
IUPAC Name | (3R,10S,13S,16S,19S)-16-[(2S)-butan-2-yl]-10,11,14,16-tetramethyl-3-(2-methylpropyl)-13-propan-2-yl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
SMILES (Canonical) | CCC(C)C1(C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C(=O)N2CCCC2C(=O)N1)CC(C)C)C)C)C(C)C)C)C |
SMILES (Isomeric) | CC[C@H](C)[C@]1(C(=O)N([C@H](C(=O)N([C@H](C(=O)NCCC(=O)O[C@@H](C(=O)N2CCC[C@H]2C(=O)N1)CC(C)C)C)C)C(C)C)C)C |
InChI | InChI=1S/C31H53N5O7/c1-11-20(6)31(8)30(42)35(10)25(19(4)5)29(41)34(9)21(7)26(38)32-15-14-24(37)43-23(17-18(2)3)28(40)36-16-12-13-22(36)27(39)33-31/h18-23,25H,11-17H2,1-10H3,(H,32,38)(H,33,39)/t20-,21-,22-,23+,25-,31-/m0/s1 |
InChI Key | VZOKXBZTQQZSRO-JDRUHKECSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H53N5O7 |
Molecular Weight | 607.80 g/mol |
Exact Mass | 607.39449905 g/mol |
Topological Polar Surface Area (TPSA) | 145.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.27% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.73% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.92% | 94.66% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 96.09% | 94.50% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 95.14% | 96.31% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 94.84% | 95.92% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.63% | 92.97% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 94.40% | 97.05% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 93.85% | 98.59% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.75% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.71% | 90.08% |
CHEMBL228 | P31645 | Serotonin transporter | 91.68% | 95.51% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.04% | 95.62% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 88.73% | 95.34% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.85% | 82.38% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.78% | 99.18% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.22% | 95.89% |
CHEMBL4616 | Q92847 | Ghrelin receptor | 87.17% | 92.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.78% | 96.47% |
CHEMBL3691 | Q13822 | Autotaxin | 86.33% | 96.39% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.03% | 90.71% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.99% | 91.03% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.85% | 93.40% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.97% | 88.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.88% | 99.23% |
CHEMBL3837 | P07711 | Cathepsin L | 84.52% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.38% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.24% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.19% | 94.75% |
CHEMBL204 | P00734 | Thrombin | 83.28% | 96.01% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.20% | 99.17% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.96% | 93.04% |
CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 81.53% | 97.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.37% | 93.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.29% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.27% | 96.38% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.11% | 94.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.98% | 89.00% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 80.86% | 92.12% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 80.63% | 97.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brassica napus |
PubChem | 163070295 |
LOTUS | LTS0023129 |
wikiData | Q105299887 |