Cyclohexane, 1-methyl-3-(1-methylethyl)-, cis-
| Internal ID | 97b23242-2756-43a3-b495-0cd9b741e79e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Monocyclic monoterpenoids |
| IUPAC Name | (1S,3R)-1-methyl-3-propan-2-ylcyclohexane |
| SMILES (Canonical) | CC1CCCC(C1)C(C)C |
| SMILES (Isomeric) | C[C@H]1CCC[C@H](C1)C(C)C |
| InChI | InChI=1S/C10H20/c1-8(2)10-6-4-5-9(3)7-10/h8-10H,4-7H2,1-3H3/t9-,10+/m0/s1 |
| InChI Key | QRDCBPPMQOPHOU-VHSXEESVSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.156500638 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.50 |
| 13837-66-6 |
| (1S,3R)-1-methyl-3-propan-2-ylcyclohexane |
| m-menthane |
| cis-m-menthan |
| QRDCBPPMQOPHOU-VHSXEESVSA-N |
| (-)-1-methyl-3-(1-methylethyl)cyclohexane |
| Cyclohexane, 1-methyl-3-(1-methylethyl)-, cis |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.63% | 95.58% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.56% | 99.18% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.54% | 97.25% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.33% | 97.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.11% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.12% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.09% | 97.09% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 85.30% | 95.27% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 82.51% | 95.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.40% | 95.89% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.14% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Juniperus communis |
| PubChem | 13117023 |
| LOTUS | LTS0136130 |
| wikiData | Q105226209 |