cyclo[Gly-Ser(Unk)-Unk-xiIle-Pro]
| Internal ID | 544a2d68-ec89-41bf-8c58-52427543a634 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (1R,4S,10S,16S,19S)-4-butan-2-yl-16-(2-methylbut-3-en-2-yloxymethyl)-19-(2-methylpropyl)-21-thia-3,6,12,15,18,23-hexazatricyclo[18.2.1.06,10]tricos-20(23)-ene-2,5,11,14,17-pentone |
| SMILES (Canonical) | CCC(C)C1C(=O)N2CCCC2C(=O)NCC(=O)NC(C(=O)NC(C3=NC(CS3)C(=O)N1)CC(C)C)COC(C)(C)C=C |
| SMILES (Isomeric) | CCC(C)[C@H]1C(=O)N2CCC[C@H]2C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C3=N[C@@H](CS3)C(=O)N1)CC(C)C)COC(C)(C)C=C |
| InChI | InChI=1S/C30H48N6O6S/c1-8-18(5)24-29(41)36-12-10-11-22(36)27(40)31-14-23(37)32-20(15-42-30(6,7)9-2)25(38)33-19(13-17(3)4)28-34-21(16-43-28)26(39)35-24/h9,17-22,24H,2,8,10-16H2,1,3-7H3,(H,31,40)(H,32,37)(H,33,38)(H,35,39)/t18?,19-,20-,21-,22-,24-/m0/s1 |
| InChI Key | FCGBWFPYRURNCX-GIBQRDCBSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C30H48N6O6S |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.33560445 g/mol |
| Topological Polar Surface Area (TPSA) | 184.00 Ų |
| XlogP | 2.30 |
| Atomic LogP (AlogP) | 1.15 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 8 |
| CHEMBL2004507 |
| NSC-691042 |
| NCI60_032671 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8571 | 85.71% |
| Caco-2 | - | 0.8316 | 83.16% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.5227 | 52.27% |
| OATP2B1 inhibitior | - | 0.7161 | 71.61% |
| OATP1B1 inhibitior | + | 0.8419 | 84.19% |
| OATP1B3 inhibitior | + | 0.9316 | 93.16% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.9369 | 93.69% |
| P-glycoprotein inhibitior | + | 0.7474 | 74.74% |
| P-glycoprotein substrate | + | 0.7902 | 79.02% |
| CYP3A4 substrate | + | 0.6936 | 69.36% |
| CYP2C9 substrate | - | 0.8024 | 80.24% |
| CYP2D6 substrate | - | 0.8433 | 84.33% |
| CYP3A4 inhibition | - | 0.6976 | 69.76% |
| CYP2C9 inhibition | - | 0.8037 | 80.37% |
| CYP2C19 inhibition | - | 0.7416 | 74.16% |
| CYP2D6 inhibition | - | 0.8878 | 88.78% |
| CYP1A2 inhibition | - | 0.8413 | 84.13% |
| CYP2C8 inhibition | + | 0.5717 | 57.17% |
| CYP inhibitory promiscuity | - | 0.9364 | 93.64% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.5457 | 54.57% |
| Eye corrosion | - | 0.9823 | 98.23% |
| Eye irritation | - | 0.9273 | 92.73% |
| Skin irritation | - | 0.7526 | 75.26% |
| Skin corrosion | - | 0.9004 | 90.04% |
| Ames mutagenesis | - | 0.5400 | 54.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5000 | 50.00% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5462 | 54.62% |
| skin sensitisation | - | 0.8212 | 82.12% |
| Respiratory toxicity | + | 0.6889 | 68.89% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | + | 0.4696 | 46.96% |
| Acute Oral Toxicity (c) | III | 0.5878 | 58.78% |
| Estrogen receptor binding | + | 0.7683 | 76.83% |
| Androgen receptor binding | + | 0.5945 | 59.45% |
| Thyroid receptor binding | + | 0.5604 | 56.04% |
| Glucocorticoid receptor binding | + | 0.6461 | 64.61% |
| Aromatase binding | + | 0.6843 | 68.43% |
| PPAR gamma | + | 0.6977 | 69.77% |
| Honey bee toxicity | - | 0.7038 | 70.38% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
| Fish aquatic toxicity | + | 0.9489 | 94.89% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.18% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.00% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.18% | 94.45% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 97.89% | 92.97% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.53% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.52% | 90.08% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 96.06% | 97.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 94.46% | 99.18% |
| CHEMBL228 | P31645 | Serotonin transporter | 93.59% | 95.51% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 92.87% | 82.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.01% | 97.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.69% | 94.66% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 91.43% | 96.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.96% | 85.14% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.76% | 98.05% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 89.71% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.44% | 96.90% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.27% | 97.64% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.83% | 93.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.67% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.81% | 86.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.80% | 89.34% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.67% | 83.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.37% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.23% | 90.17% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.94% | 91.03% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.60% | 90.24% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.11% | 92.88% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 85.28% | 94.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.12% | 95.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.84% | 96.38% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.06% | 98.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.69% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.45% | 93.40% |
| CHEMBL1801 | P00747 | Plasminogen | 83.25% | 92.44% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 83.16% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.02% | 97.14% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.76% | 93.65% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.67% | 91.11% |
| CHEMBL3691 | Q13822 | Autotaxin | 82.57% | 96.39% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.15% | 98.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.80% | 95.56% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.90% | 94.45% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 80.78% | 94.36% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.58% | 91.43% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.58% | 88.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.48% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.39% | 99.23% |
| CHEMBL4071 | P08311 | Cathepsin G | 80.33% | 94.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 391587 |
| LOTUS | LTS0265171 |
| wikiData | Q104401444 |