cyclo[Gly-Gly-Pro-Phe-Pro-Gly-Tyr]
| Internal ID | 62210b76-389f-4f0a-b93a-8ff7448e1759 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (3S,6S,18S,24S)-3-benzyl-18-[(4-hydroxyphenyl)methyl]-1,4,10,13,16,19,22-heptazatricyclo[22.3.0.06,10]heptacosane-2,5,11,14,17,20,23-heptone |
| SMILES (Canonical) | C1CC2C(=O)NC(C(=O)N3CCCC3C(=O)NCC(=O)NC(C(=O)NCC(=O)NCC(=O)N2C1)CC4=CC=C(C=C4)O)CC5=CC=CC=C5 |
| SMILES (Isomeric) | C1C[C@H]2C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N2C1)CC4=CC=C(C=C4)O)CC5=CC=CC=C5 |
| InChI | InChI=1S/C34H41N7O8/c42-23-12-10-22(11-13-23)16-24-31(46)36-18-28(43)35-20-30(45)40-14-4-9-27(40)33(48)39-25(17-21-6-2-1-3-7-21)34(49)41-15-5-8-26(41)32(47)37-19-29(44)38-24/h1-3,6-7,10-13,24-27,42H,4-5,8-9,14-20H2,(H,35,43)(H,36,46)(H,37,47)(H,38,44)(H,39,48)/t24-,25-,26-,27-/m0/s1 |
| InChI Key | LKSLULKDJJRELU-FWEHEUNISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H41N7O8 |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.30166129 g/mol |
| Topological Polar Surface Area (TPSA) | 206.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
![2D Structure of cyclo[Gly-Gly-Pro-Phe-Pro-Gly-Tyr]](https://plantaedb.com/storage/docs/compounds/2023/11/cyclogly-gly-pro-phe-pro-gly-tyr.jpg "2D Structure of cyclo[Gly-Gly-Pro-Phe-Pro-Gly-Tyr]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.29% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.86% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.76% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.46% | 91.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.02% | 92.97% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.43% | 85.14% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.34% | 97.05% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.85% | 90.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.66% | 95.56% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.63% | 82.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.52% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.29% | 90.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.76% | 93.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.70% | 92.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.37% | 94.45% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 87.54% | 90.65% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.19% | 95.62% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.95% | 91.71% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 84.68% | 87.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.88% | 97.09% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.72% | 96.39% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.61% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stellaria yunnanensis |
| PubChem | 10055293 |
| LOTUS | LTS0174595 |
| wikiData | Q105153259 |