cyclo[DL-Phe-DL-Pro-DL-xiIle-DL-xiIle-DL-Pro-DL-Tyr-DL-Pro]
| Internal ID | 30d44bb5-5ace-41d0-a379-0aad8b379bf7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 3-benzyl-21,24-di(butan-2-yl)-12-[(4-hydroxyphenyl)methyl]-1,4,10,13,19,22,25-heptazatetracyclo[25.3.0.06,10.015,19]triacontane-2,5,11,14,20,23,26-heptone |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)N4CCCC4C(=O)N1)CC5=CC=CC=C5)CC6=CC=C(C=C6)O)C(C)CC |
| SMILES (Isomeric) | CCC(C)C1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)N4CCCC4C(=O)N1)CC5=CC=CC=C5)CC6=CC=C(C=C6)O)C(C)CC |
| InChI | InChI=1S/C45H61N7O8/c1-5-27(3)37-42(57)49-38(28(4)6-2)45(60)52-24-12-16-35(52)40(55)47-33(26-30-18-20-31(53)21-19-30)44(59)50-22-10-15-34(50)39(54)46-32(25-29-13-8-7-9-14-29)43(58)51-23-11-17-36(51)41(56)48-37/h7-9,13-14,18-21,27-28,32-38,53H,5-6,10-12,15-17,22-26H2,1-4H3,(H,46,54)(H,47,55)(H,48,56)(H,49,57) |
| InChI Key | LNXDZKNDLBCPBR-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C45H61N7O8 |
| Molecular Weight | 828.00 g/mol |
| Exact Mass | 827.45816193 g/mol |
| Topological Polar Surface Area (TPSA) | 198.00 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of cyclo[DL-Phe-DL-Pro-DL-xiIle-DL-xiIle-DL-Pro-DL-Tyr-DL-Pro]](https://plantaedb.com/storage/docs/compounds/2023/11/cyclodl-phe-dl-pro-dl-xiile-dl-xiile-dl-pro-dl-tyr-dl-pro.jpg "2D Structure of cyclo[DL-Phe-DL-Pro-DL-xiIle-DL-xiIle-DL-Pro-DL-Tyr-DL-Pro]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.83% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.95% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.21% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.62% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.43% | 90.08% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.48% | 97.64% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.25% | 95.89% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 92.86% | 82.38% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.18% | 94.45% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.94% | 90.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.30% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.65% | 91.11% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.61% | 92.67% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.29% | 91.71% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 86.99% | 92.97% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.91% | 97.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.32% | 99.18% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.30% | 93.00% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 84.00% | 95.48% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.40% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.79% | 86.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.07% | 95.93% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.18% | 95.89% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 81.05% | 92.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.90% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75069325 |
| LOTUS | LTS0074725 |
| wikiData | Q105154558 |