cyclo[DL-Asn-DL-Gln-DL-Tyr-DL-Val-DL-Orn-DL-Leu-DL-Phe-DL-Pro-DL-Leu-DL-Trp]
| Internal ID | 0b9b09d8-a78a-4a1d-8ab4-a05202ad7843 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 3-[21-(2-amino-2-oxoethyl)-9-(3-aminopropyl)-3-benzyl-15-[(4-hydroxyphenyl)methyl]-24-(1H-indol-3-ylmethyl)-6,27-bis(2-methylpropyl)-2,5,8,11,14,17,20,23,26,29-decaoxo-12-propan-2-yl-1,4,7,10,13,16,19,22,25,28-decazabicyclo[28.3.0]tritriacontan-18-yl]propanamide |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)CC(C)C)CCCN)C(C)C)CC4=CC=C(C=C4)O)CCC(=O)N)CC(=O)N)CC5=CNC6=CC=CC=C65 |
| SMILES (Isomeric) | CC(C)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)CC(C)C)CCCN)C(C)C)CC4=CC=C(C=C4)O)CCC(=O)N)CC(=O)N)CC5=CNC6=CC=CC=C65 |
| InChI | InChI=1S/C65H90N14O13/c1-35(2)28-46-59(86)77-51(31-38-14-8-7-9-15-38)65(92)79-27-13-19-52(79)63(90)76-47(29-36(3)4)58(85)74-49(32-40-34-69-43-17-11-10-16-42(40)43)60(87)75-50(33-54(68)82)61(88)70-45(24-25-53(67)81)57(84)73-48(30-39-20-22-41(80)23-21-39)62(89)78-55(37(5)6)64(91)71-44(18-12-26-66)56(83)72-46/h7-11,14-17,20-23,34-37,44-52,55,69,80H,12-13,18-19,24-33,66H2,1-6H3,(H2,67,81)(H2,68,82)(H,70,88)(H,71,91)(H,72,83)(H,73,84)(H,74,85)(H,75,87)(H,76,90)(H,77,86)(H,78,89) |
| InChI Key | CFLSWSZLIXSQDV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C65H90N14O13 |
| Molecular Weight | 1275.50 g/mol |
| Exact Mass | 1274.68117898 g/mol |
| Topological Polar Surface Area (TPSA) | 430.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.49% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.89% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.07% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.73% | 94.45% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.45% | 97.64% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.00% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.88% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.74% | 90.08% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 93.62% | 96.25% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.98% | 82.38% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.27% | 88.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.23% | 91.71% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 88.35% | 88.10% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.90% | 96.47% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.32% | 90.71% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.13% | 96.11% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.57% | 95.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.13% | 99.18% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.35% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.79% | 99.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.53% | 92.97% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.72% | 95.62% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 83.48% | 96.31% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.11% | 94.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.67% | 83.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.63% | 86.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.30% | 94.62% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.27% | 97.05% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.99% | 85.00% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 80.89% | 99.09% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 80.89% | 96.69% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.81% | 95.50% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.81% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73110018 |
| LOTUS | LTS0079506 |
| wikiData | Q103817691 |