cyclo[DL-Abu-DL-Ser-bPhe-DL-Ser-DL-Pro]
| Internal ID | 38850778-e567-4866-a93e-60e0e015cc55 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 13-ethyl-3,10-bis(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
| SMILES (Canonical) | CCC1C(=O)NC(C(=O)NC(CC(=O)NC(C(=O)N2CCCC2C(=O)N1)CO)C3=CC=CC=C3)CO |
| SMILES (Isomeric) | CCC1C(=O)NC(C(=O)NC(CC(=O)NC(C(=O)N2CCCC2C(=O)N1)CO)C3=CC=CC=C3)CO |
| InChI | InChI=1S/C24H33N5O7/c1-2-15-21(33)28-17(12-30)22(34)27-16(14-7-4-3-5-8-14)11-20(32)25-18(13-31)24(36)29-10-6-9-19(29)23(35)26-15/h3-5,7-8,15-19,30-31H,2,6,9-13H2,1H3,(H,25,32)(H,26,35)(H,27,34)(H,28,33) |
| InChI Key | JAPQCCQLPMCXRC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.23799841 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | -0.40 |
| There are no found synonyms. |
![2D Structure of cyclo[DL-Abu-DL-Ser-bPhe-DL-Ser-DL-Pro]](https://plantaedb.com/storage/docs/compounds/2023/11/cyclodl-abu-dl-ser-bphe-dl-ser-dl-pro.jpg "2D Structure of cyclo[DL-Abu-DL-Ser-bPhe-DL-Ser-DL-Pro]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.24% | 98.95% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 97.57% | 92.97% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.46% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.66% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.57% | 97.25% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.76% | 97.05% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.55% | 82.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.26% | 95.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.03% | 97.64% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.16% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.54% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.57% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.17% | 90.08% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.44% | 93.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.70% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.47% | 83.82% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 80.88% | 94.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.06% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162814506 |
| LOTUS | LTS0082209 |
| wikiData | Q104169337 |