Cyclo(D-Tyr-L-Leu)
| Internal ID | 961f57bf-fa69-4e24-96e9-a064d02e17b1 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (3R,6S)-3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O |
| SMILES (Isomeric) | CC(C)C[C@H]1C(=O)N[C@@H](C(=O)N1)CC2=CC=C(C=C2)O |
| InChI | InChI=1S/C15H20N2O3/c1-9(2)7-12-14(19)17-13(15(20)16-12)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8H2,1-2H3,(H,16,20)(H,17,19)/t12-,13+/m0/s1 |
| InChI Key | GENSLUDVKWKQMX-QWHCGFSZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 78.40 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.78% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.12% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.35% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.31% | 96.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.57% | 90.93% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.58% | 90.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.24% | 91.11% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.39% | 97.23% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.27% | 89.67% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.18% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.79% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.55% | 97.25% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.31% | 95.89% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.08% | 83.10% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.61% | 85.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.11% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.28% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 124350923 |
| LOTUS | LTS0086163 |
| wikiData | Q77564463 |