Cycloartanol, 14-methyl-
Internal ID | c0767c42-c01a-454d-bf34-8de09680e370 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | 7,7,12,16-tetramethyl-15-(6-methylheptan-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
SMILES (Canonical) | CC(C)CCCC(C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
SMILES (Isomeric) | CC(C)CCCC(C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
InChI | InChI=1S/C30H52O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h20-25,31H,8-19H2,1-7H3 |
InChI Key | YABASAWVVRQMEU-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H52O |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.401816278 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 10.20 |
Cycloartanol, 14-methyl- |
SCHEMBL12152356 |
DTXSID30310366 |
YABASAWVVRQMEU-UHFFFAOYSA-N |
AKOS032948856 |
(1S,3R,6S,8R,12S,15R,16R)-7,7,12,16-Tetramethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
1-(1,5-Dimethylhexyl)-3a,6,6,12a-tetramethyltetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-ol # |
7,7,12,16-tetramethyl-15-(6-methylheptan-2-yl)pentacyclo[9.7.0.0^{1,3.0^{3,8.0^{12,16]octadecan-6-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.00% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.05% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.74% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 92.31% | 95.58% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.69% | 85.31% |
CHEMBL2581 | P07339 | Cathepsin D | 90.66% | 98.95% |
CHEMBL3837 | P07711 | Cathepsin L | 90.58% | 96.61% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.89% | 92.86% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.25% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.75% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.91% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.61% | 93.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.44% | 82.69% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.98% | 98.10% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.39% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.33% | 97.79% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.28% | 96.95% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.12% | 90.24% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.84% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.75% | 94.75% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.17% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.05% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.96% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.51% | 90.71% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.26% | 99.35% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.70% | 97.29% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.50% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.26% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.17% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Dioscorea alata |
Erythrophleum fordii |
Maquira coriacea |
Sapium haematospermum |
PubChem | 313075 |
LOTUS | LTS0059585 |
wikiData | Q105345283 |