cyclo[Ala-Gly-Val-Val-Leu-Pro-Gly]
Internal ID | 2d65eebe-4d57-4362-8dee-984de7b4f4c5 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | (3S,6S,9S,15S,21S)-15-methyl-3-(2-methylpropyl)-6,9-di(propan-2-yl)-1,4,7,10,13,16,19-heptazabicyclo[19.3.0]tetracosane-2,5,8,11,14,17,20-heptone |
SMILES (Canonical) | CC1C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NCC(=O)N1)CC(C)C)C(C)C)C(C)C |
SMILES (Isomeric) | C[C@H]1C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)NCC(=O)N1)CC(C)C)C(C)C)C(C)C |
InChI | InChI=1S/C28H47N7O7/c1-14(2)11-18-28(42)35-10-8-9-19(35)25(39)30-12-20(36)31-17(7)24(38)29-13-21(37)33-22(15(3)4)27(41)34-23(16(5)6)26(40)32-18/h14-19,22-23H,8-13H2,1-7H3,(H,29,38)(H,30,39)(H,31,36)(H,32,40)(H,33,37)(H,34,41)/t17-,18-,19-,22-,23-/m0/s1 |
InChI Key | HMOQVVSQHRZSGU-PTRTWWQBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H47N7O7 |
Molecular Weight | 593.70 g/mol |
Exact Mass | 593.35369686 g/mol |
Topological Polar Surface Area (TPSA) | 195.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.29% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.65% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.29% | 96.09% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.23% | 96.31% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 96.51% | 92.97% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.47% | 90.08% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 94.61% | 97.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.59% | 85.14% |
CHEMBL228 | P31645 | Serotonin transporter | 94.52% | 95.51% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.88% | 95.93% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.52% | 92.12% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.67% | 99.18% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.88% | 94.66% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.12% | 97.09% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.01% | 91.03% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.87% | 96.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.52% | 94.75% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.94% | 82.38% |
CHEMBL2443 | P49862 | Kallikrein 7 | 88.27% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.09% | 90.71% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.42% | 88.56% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.14% | 90.24% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.97% | 97.64% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.57% | 86.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.33% | 95.89% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 84.88% | 99.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.55% | 90.93% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 84.51% | 96.69% |
CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 84.37% | 97.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.11% | 95.50% |
CHEMBL1949 | P62937 | Cyclophilin A | 83.97% | 98.57% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.30% | 93.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.24% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.15% | 97.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.89% | 96.38% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 82.69% | 94.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.52% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona glauca |
PubChem | 11478874 |
LOTUS | LTS0120600 |
wikiData | Q105030605 |