(2R,8R,14S,17R,20S,25S,28R,29S)-8-[(2R)-butan-2-yl]-2-[(2S)-butan-2-yl]-28-ethyl-17-[(4-methoxyphenyl)methyl]-7,13,16,20,22,22,25,29-octamethyl-14-propan-2-yl-1-oxa-4,7,10,13,16,19,24,27-octazacyclotriacontane-3,6,9,12,15,18,21,23,26,30-decone
| Internal ID | 69678179-a8a4-4260-8579-efa36504ba2b |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R,8R,14S,17R,20S,25S,28R,29S)-8-[(2R)-butan-2-yl]-2-[(2S)-butan-2-yl]-28-ethyl-17-[(4-methoxyphenyl)methyl]-7,13,16,20,22,22,25,29-octamethyl-14-propan-2-yl-1-oxa-4,7,10,13,16,19,24,27-octazacyclotriacontane-3,6,9,12,15,18,21,23,26,30-decone |
| SMILES (Canonical) | CCC1C(C(=O)OC(C(=O)NCC(=O)N(C(C(=O)NCC(=O)N(C(C(=O)N(C(C(=O)NC(C(=O)C(C(=O)NC(C(=O)N1)C)(C)C)C)CC2=CC=C(C=C2)OC)C)C(C)C)C)C(C)CC)C)C(C)CC)C |
| SMILES (Isomeric) | CC[C@@H]1[C@@H](C(=O)O[C@@H](C(=O)NCC(=O)N([C@@H](C(=O)NCC(=O)N([C@H](C(=O)N([C@@H](C(=O)N[C@H](C(=O)C(C(=O)N[C@H](C(=O)N1)C)(C)C)C)CC2=CC=C(C=C2)OC)C)C(C)C)C)[C@H](C)CC)C)[C@@H](C)CC)C |
| InChI | InChI=1S/C50H80N8O12/c1-17-28(6)40-45(64)51-25-37(59)57(14)39(27(4)5)47(66)56(13)36(24-33-20-22-34(69-16)23-21-33)44(63)53-31(9)42(61)50(11,12)49(68)54-32(10)43(62)55-35(19-3)30(8)48(67)70-41(29(7)18-2)46(65)52-26-38(60)58(40)15/h20-23,27-32,35-36,39-41H,17-19,24-26H2,1-16H3,(H,51,64)(H,52,65)(H,53,63)(H,54,68)(H,55,62)/t28-,29+,30+,31+,32+,35-,36-,39+,40-,41-/m1/s1 |
| InChI Key | KDZUJZSBNBCYEK-PUIYVOTRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C50H80N8O12 |
| Molecular Weight | 985.20 g/mol |
| Exact Mass | 984.58957002 g/mol |
| Topological Polar Surface Area (TPSA) | 259.00 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.35% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.91% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.14% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.12% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.60% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.34% | 98.59% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.00% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.88% | 93.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.96% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.95% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 92.49% | 90.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.81% | 95.89% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.76% | 90.17% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 91.31% | 96.69% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.00% | 94.66% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.74% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.85% | 97.09% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.02% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.32% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.02% | 90.08% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.86% | 91.03% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.39% | 91.07% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.20% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.56% | 96.00% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 82.27% | 92.00% |
| CHEMBL1949 | P62937 | Cyclophilin A | 82.21% | 98.57% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.02% | 90.71% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.88% | 96.77% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.56% | 92.88% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.40% | 100.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 80.64% | 96.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162980176 |
| LOTUS | LTS0090858 |
| wikiData | Q105139832 |