Cyclo-[phenylalanyl-prolyl-leucyl-prolyl]
| Internal ID | ae986d53-e7f5-4d31-9ff7-d7fc9cea6214 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (3S,6S,12S,15S)-3-benzyl-12-(2-methylpropyl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
| SMILES (Canonical) | CC(C)CC1C(=O)N2CCCC2C(=O)NC(C(=O)N3CCCC3C(=O)N1)CC4=CC=CC=C4 |
| SMILES (Isomeric) | CC(C)C[C@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)N1)CC4=CC=CC=C4 |
| InChI | InChI=1S/C25H34N4O4/c1-16(2)14-18-24(32)28-12-6-11-21(28)23(31)27-19(15-17-8-4-3-5-9-17)25(33)29-13-7-10-20(29)22(30)26-18/h3-5,8-9,16,18-21H,6-7,10-15H2,1-2H3,(H,26,30)(H,27,31)/t18-,19-,20-,21-/m0/s1 |
| InChI Key | DGVAQUZMNFTFKE-TUFLPTIASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.25800558 g/mol |
| Topological Polar Surface Area (TPSA) | 98.80 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of Cyclo-[phenylalanyl-prolyl-leucyl-prolyl]](https://plantaedb.com/storage/docs/compounds/2023/11/cyclo-phenylalanyl-prolyl-leucyl-prolyl.jpg "2D Structure of Cyclo-[phenylalanyl-prolyl-leucyl-prolyl]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 96.35% | 92.97% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.02% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.57% | 85.14% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 89.78% | 96.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.04% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.01% | 90.08% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.85% | 82.38% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.90% | 97.05% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.51% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.15% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.12% | 94.45% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 85.35% | 90.65% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.34% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.33% | 90.17% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.68% | 93.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.55% | 97.14% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 81.80% | 91.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.13% | 86.33% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.02% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24851291 |
| LOTUS | LTS0072181 |
| wikiData | Q77381110 |