Cyanopeptoline CB071
| Internal ID | eb3c6519-822d-4806-95ce-5edf470aef97 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4S)-5-[[(5S,11R,12R,15S,21R)-2-[(2S)-butan-2-yl]-5-[(3-chloro-4-methoxyphenyl)methyl]-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-4-(hexanoylamino)-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCC(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(N(C(=O)C(N2C(CCC(C2=O)NC(=O)C(NC1=O)CCCN=C(N)N)O)C(C)CC)C)CC3=CC(=C(C=C3)OC)Cl)C(C)C)C |
| SMILES (Isomeric) | CCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]1[C@H](OC(=O)C(NC(=O)[C@@H](N(C(=O)C(N2[C@@H](CCC(C2=O)NC(=O)[C@@H](NC1=O)CCCN=C(N)N)O)[C@@H](C)CC)C)CC3=CC(=C(C=C3)OC)Cl)C(C)C)C |
| InChI | InChI=1S/C48H75ClN10O13/c1-9-11-12-15-35(60)53-31(18-21-37(62)63)42(65)57-39-27(6)72-47(70)38(25(3)4)56-43(66)33(24-28-16-19-34(71-8)29(49)23-28)58(7)46(69)40(26(5)10-2)59-36(61)20-17-32(45(59)68)55-41(64)30(54-44(39)67)14-13-22-52-48(50)51/h16,19,23,25-27,30-33,36,38-40,61H,9-15,17-18,20-22,24H2,1-8H3,(H,53,60)(H,54,67)(H,55,64)(H,56,66)(H,57,65)(H,62,63)(H4,50,51,52)/t26-,27+,30-,31-,32?,33-,36+,38?,39+,40?/m0/s1 |
| InChI Key | NCIYGUIDUVAJPC-AZARJOBUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C48H75ClN10O13 |
| Molecular Weight | 1035.60 g/mol |
| Exact Mass | 1034.5203602 g/mol |
| Topological Polar Surface Area (TPSA) | 344.00 Ų |
| XlogP | 2.80 |
| Atomic LogP (AlogP) | 0.60 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8046 | 80.46% |
| Caco-2 | - | 0.8608 | 86.08% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Lysosomes | 0.5270 | 52.70% |
| OATP2B1 inhibitior | - | 0.8581 | 85.81% |
| OATP1B1 inhibitior | + | 0.8078 | 80.78% |
| OATP1B3 inhibitior | + | 0.9284 | 92.84% |
| MATE1 inhibitior | - | 0.7600 | 76.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.8521 | 85.21% |
| P-glycoprotein inhibitior | + | 0.7460 | 74.60% |
| P-glycoprotein substrate | + | 0.8778 | 87.78% |
| CYP3A4 substrate | + | 0.7496 | 74.96% |
| CYP2C9 substrate | - | 0.7913 | 79.13% |
| CYP2D6 substrate | - | 0.8534 | 85.34% |
| CYP3A4 inhibition | - | 0.7710 | 77.10% |
| CYP2C9 inhibition | - | 0.7710 | 77.10% |
| CYP2C19 inhibition | - | 0.7179 | 71.79% |
| CYP2D6 inhibition | - | 0.8303 | 83.03% |
| CYP1A2 inhibition | - | 0.8032 | 80.32% |
| CYP2C8 inhibition | + | 0.8233 | 82.33% |
| CYP inhibitory promiscuity | - | 0.9749 | 97.49% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.7400 | 74.00% |
| Carcinogenicity (trinary) | Non-required | 0.5792 | 57.92% |
| Eye corrosion | - | 0.9825 | 98.25% |
| Eye irritation | - | 0.9008 | 90.08% |
| Skin irritation | - | 0.7675 | 76.75% |
| Skin corrosion | - | 0.9224 | 92.24% |
| Ames mutagenesis | - | 0.5982 | 59.82% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4002 | 40.02% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | - | 0.5633 | 56.33% |
| skin sensitisation | - | 0.8366 | 83.66% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | + | 0.4603 | 46.03% |
| Acute Oral Toxicity (c) | III | 0.5927 | 59.27% |
| Estrogen receptor binding | + | 0.8039 | 80.39% |
| Androgen receptor binding | + | 0.6995 | 69.95% |
| Thyroid receptor binding | + | 0.6094 | 60.94% |
| Glucocorticoid receptor binding | + | 0.5804 | 58.04% |
| Aromatase binding | + | 0.6896 | 68.96% |
| PPAR gamma | + | 0.7796 | 77.96% |
| Honey bee toxicity | - | 0.6916 | 69.16% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
| Fish aquatic toxicity | + | 0.9700 | 97.00% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.69% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.64% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.61% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.33% | 99.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.51% | 96.61% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.39% | 93.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.09% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.77% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.90% | 97.14% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 93.87% | 96.90% |
| CHEMBL4072 | P07858 | Cathepsin B | 93.47% | 93.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.12% | 86.33% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 92.58% | 89.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.35% | 94.66% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.09% | 92.08% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 92.05% | 95.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.87% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.63% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.57% | 90.20% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.64% | 90.71% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.26% | 92.29% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.99% | 91.19% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.79% | 96.38% |
| CHEMBL1949 | P62937 | Cyclophilin A | 89.70% | 98.57% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.31% | 92.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.18% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.17% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.56% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.42% | 93.03% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 88.19% | 99.52% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 88.07% | 85.83% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.10% | 95.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.02% | 92.32% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.99% | 95.50% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 84.38% | 97.00% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 84.04% | 96.76% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.97% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.60% | 97.64% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.86% | 96.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.83% | 90.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.55% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587483 |
| LOTUS | LTS0111318 |
| wikiData | Q77567249 |