Cyanidin 3-O-[2''-O-(2'''-O-(sinapoyl) xylosyl) glucoside] 5-O-glucoside
Internal ID | e691546c-a8c7-481b-82a1-ead368eddc5a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-5-O-glycosides |
IUPAC Name | [(2S,3R,5R)-2-[(2S,4S,5S)-2-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OC2C(C(COC2OC3C(C(C(OC3OC4=C([O+]=C5C=C(C=C(C5=C4)OC6C(C(C(C(O6)CO)O)O)O)O)C7=CC(=C(C=C7)O)O)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O[C@H]2[C@@H](OC[C@H](C2O)O)OC3[C@H]([C@@H](C(O[C@H]3OC4=C([O+]=C5C=C(C=C(C5=C4)O[C@H]6C([C@H]([C@@H](C(O6)CO)O)O)O)O)C7=CC(=C(C=C7)O)O)CO)O)O |
InChI | InChI=1S/C43H48O24/c1-58-25-7-16(8-26(59-2)32(25)52)3-6-30(50)66-39-31(51)22(49)15-60-42(39)67-40-36(56)34(54)29(14-45)65-43(40)63-27-12-19-23(61-38(27)17-4-5-20(47)21(48)9-17)10-18(46)11-24(19)62-41-37(57)35(55)33(53)28(13-44)64-41/h3-12,22,28-29,31,33-37,39-45,49,51,53-57H,13-15H2,1-2H3,(H3-,46,47,48,50,52)/p+1/t22-,28?,29?,31?,33-,34-,35+,36+,37?,39-,40?,41-,42+,43-/m1/s1 |
InChI Key | HKRACDHMWOGFKJ-ODJWTQCBSA-O |
Popularity | 0 references in papers |
Molecular Formula | C43H49O24+ |
Molecular Weight | 949.80 g/mol |
Exact Mass | 949.26137743 g/mol |
Topological Polar Surface Area (TPSA) | 364.00 Ų |
XlogP | 0.00 |
LMPK12010195 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.28% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.81% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.71% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.85% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.56% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.00% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.77% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 91.24% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.12% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.23% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.09% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.15% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 87.02% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.01% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.97% | 94.73% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.94% | 97.28% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.17% | 94.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.81% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.73% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.71% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.15% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.00% | 94.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.91% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.01% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.55% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.88% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.69% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 44256800 |
LOTUS | LTS0168515 |
wikiData | Q23464998 |