Curassavioside H5
Internal ID | fb196d31-4155-4152-9657-dc7664c2ab19 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,5S,8S,9R,10S,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5S,6R)-4-hydroxy-5-[(2S,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4O)OC5CCC6(C(C5)CCC7(C6CC(C8(C7(CCC8(C(=O)C)O)O)C)OC(=O)C=CC9=CC=CC=C9)O)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4O)O[C@H]5CC[C@]6([C@H](C5)CC[C@@]7([C@@H]6C[C@H]([C@]8([C@@]7(CC[C@]8(C(=O)C)O)O)C)OC(=O)/C=C/C9=CC=CC=C9)O)C)C)C)C)OC)O |
InChI | InChI=1S/C57H86O19/c1-30-49(61)39(65-8)26-46(68-30)75-51-33(4)71-48(28-41(51)67-10)76-52-32(3)70-47(27-40(52)66-9)74-50-31(2)69-45(25-38(50)59)72-37-19-20-53(6)36(24-37)18-21-56(63)42(53)29-43(73-44(60)17-16-35-14-12-11-13-15-35)54(7)55(62,34(5)58)22-23-57(54,56)64/h11-17,30-33,36-43,45-52,59,61-64H,18-29H2,1-10H3/b17-16+/t30-,31-,32-,33-,36+,37+,38+,39-,40-,41-,42-,43-,45+,46+,47+,48+,49-,50-,51-,52-,53+,54-,55-,56+,57-/m1/s1 |
InChI Key | NWIQAVQUXHUXEE-MXWVNINQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C57H86O19 |
Molecular Weight | 1075.30 g/mol |
Exact Mass | 1074.57633051 g/mol |
Topological Polar Surface Area (TPSA) | 246.00 Ų |
XlogP | 3.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.20% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.19% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.58% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.32% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.09% | 89.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.25% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.01% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 89.95% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.94% | 94.08% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.70% | 94.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.87% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.86% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.47% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.16% | 89.67% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.97% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.31% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 82.01% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.88% | 99.23% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.40% | 89.44% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.05% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.84% | 92.62% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.52% | 97.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.16% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anemone narcissiflora |
Asclepias curassavica |
Hyperbaena columbica |
Viburnum lantanoides |
PubChem | 101841597 |
NPASS | NPC136146 |
LOTUS | LTS0100400 |
wikiData | Q105186622 |