Curacozole
| Internal ID | 73bb093b-77bb-455a-adda-6e2dc247347c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 20,23-di(butan-2-yl)-4-methyl-16-phenyl-3,15,28-trioxa-7,11-dithia-19,22,25,30,31,32,33,34-octazahexacyclo[25.2.1.12,5.16,9.110,13.114,17]tetratriaconta-1(29),2(34),4,6(33),8,10(32),12,14(31),16,27(30)-decaene-18,21,24-trione |
| SMILES (Canonical) | CCC(C)C1C(=O)NCC2=NC(=CO2)C3=NC(=C(O3)C)C4=NC(=CS4)C5=NC(=CS5)C6=NC(=C(O6)C7=CC=CC=C7)C(=O)NC(C(=O)N1)C(C)CC |
| SMILES (Isomeric) | CCC(C)C1C(=O)NCC2=NC(=CO2)C3=NC(=C(O3)C)C4=NC(=CS4)C5=NC(=CS5)C6=NC(=C(O6)C7=CC=CC=C7)C(=O)NC(C(=O)N1)C(C)CC |
| InChI | InChI=1S/C36H36N8O6S2/c1-6-17(3)25-30(45)37-13-24-38-21(14-48-24)33-43-27(19(5)49-33)36-40-23(16-52-36)35-39-22(15-51-35)34-44-28(29(50-34)20-11-9-8-10-12-20)32(47)42-26(18(4)7-2)31(46)41-25/h8-12,14-18,25-26H,6-7,13H2,1-5H3,(H,37,45)(H,41,46)(H,42,47) |
| InChI Key | GARMIUZCKGLXIH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C36H36N8O6S2 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.21992324 g/mol |
| Topological Polar Surface Area (TPSA) | 248.00 Ų |
| XlogP | 5.40 |
| CHEBI:156428 |
| NSC806989 |
| NSC-806989 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.33% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.70% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.45% | 86.33% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 92.26% | 87.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.14% | 94.00% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 89.36% | 88.84% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.36% | 93.00% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.94% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.38% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.43% | 90.17% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.24% | 93.03% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.03% | 95.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.03% | 97.79% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.90% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.50% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.74% | 95.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.49% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.48% | 90.71% |
| CHEMBL1801 | P00747 | Plasminogen | 82.44% | 92.44% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.39% | 97.53% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 81.95% | 95.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.87% | 81.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.45% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.12% | 98.59% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.10% | 91.11% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.99% | 96.67% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 80.82% | 95.48% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.75% | 93.99% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720670 |
| LOTUS | LTS0219581 |
| wikiData | Q104166957 |