Cuneataside C
Internal ID | 848dd77d-a722-4742-a04c-3c288ff6cd0c |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[2-(3,4-dihydroxyphenyl)ethoxy]oxane-3,4,5-triol |
SMILES (Canonical) | C1C(C(C(O1)OCC2C(C(C(C(O2)OCCC3=CC(=C(C=C3)O)O)O)O)O)O)(CO)O |
SMILES (Isomeric) | C1[C@@]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OCCC3=CC(=C(C=C3)O)O)O)O)O)O)(CO)O |
InChI | InChI=1S/C19H28O12/c20-7-19(27)8-30-18(16(19)26)29-6-12-13(23)14(24)15(25)17(31-12)28-4-3-9-1-2-10(21)11(22)5-9/h1-2,5,12-18,20-27H,3-4,6-8H2/t12-,13-,14+,15-,16+,17-,18-,19-/m1/s1 |
InChI Key | LBHKVQMODMELAS-OTCFHACESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H28O12 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | -2.60 |
CHEMBL376387 |
871720-16-0 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.80% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.21% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.06% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.95% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.85% | 94.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.37% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.14% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.40% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.15% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.50% | 96.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.75% | 99.15% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.92% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 84.65% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.23% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.30% | 94.73% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.97% | 96.37% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.18% | 92.68% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.89% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.33% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fraxinus sieboldiana |
Sargentodoxa cuneata |
PubChem | 11503277 |
NPASS | NPC90318 |
ChEMBL | CHEMBL376387 |
LOTUS | LTS0218855 |
wikiData | Q105149271 |