Crystamidine
Internal ID | 935ba873-4807-42fa-9322-910b83cfd8a0 |
Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
IUPAC Name | (1S,19R)-19-methoxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,11,15,17-hexaen-14-one |
SMILES (Canonical) | COC1CC23C(=CC(=O)N2C=CC4=CC5=C(C=C34)OCO5)C=C1 |
SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CC(=O)N2C=CC4=CC5=C(C=C34)OCO5)C=C1 |
InChI | InChI=1S/C18H15NO4/c1-21-13-3-2-12-7-17(20)19-5-4-11-6-15-16(23-10-22-15)8-14(11)18(12,19)9-13/h2-8,13H,9-10H2,1H3/t13-,18-/m0/s1 |
InChI Key | NZMLLYZLUYBOGO-UGSOOPFHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H15NO4 |
Molecular Weight | 309.30 g/mol |
Exact Mass | 309.10010796 g/mol |
Topological Polar Surface Area (TPSA) | 48.00 Ų |
XlogP | 1.40 |
(+)-Crystamidine |
NC303MS62R |
UNII-NC303MS62R |
58779-39-8 |
Erythrinan-8-one, 1,2,6,7,10,11-hexadehydro-3-methoxy-15,16-(methylenebis(oxy))-, (3beta)- |
Q27284789 |
ERYTHRINAN-8-ONE, 1,2,6,7,10,11-HEXADEHYDRO-3-METHOXY-15,16-(METHYLENEBIS(OXY))-, (3.BETA.)- |
![2D Structure of Crystamidine 2D Structure of Crystamidine](https://plantaedb.com/storage/docs/compounds/2023/11/crystamidine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.97% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.02% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.33% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.10% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.83% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.43% | 92.62% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.74% | 89.63% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.72% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.85% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.51% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.79% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.09% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.34% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.91% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina americana |
Erythrina brucei |
Erythrina crista-galli |
PubChem | 101922024 |
LOTUS | LTS0084250 |
wikiData | Q27284789 |