Cryptopleurine
Internal ID | 4a4c873e-5fff-4705-bf8a-3bb83980b6f8 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthroquinolizidines |
IUPAC Name | (14aR)-2,3,6-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine |
SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(CC4CCCCN4C3)C5=CC(=C(C=C52)OC)OC |
SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C[C@H]4CCCCN4C3)C5=CC(=C(C=C52)OC)OC |
InChI | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3/t15-/m1/s1 |
InChI Key | RSHYSOGXGSUUIJ-OAHLLOKOSA-N |
Popularity | 42 references in papers |
Molecular Formula | C24H27NO3 |
Molecular Weight | 377.50 g/mol |
Exact Mass | 377.19909372 g/mol |
Topological Polar Surface Area (TPSA) | 30.90 Ų |
XlogP | 5.10 |
482-22-4 |
R-Cryptopleurine |
CRYPTOPLEURINE (I) |
(-)-Cryptopleurine |
NSC19912 |
CHEBI:3932 |
(14aR)-2,3,6-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine |
UNII-3JZK58H75B |
3JZK58H75B |
NSC 19912 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3438 | Q05513 | Protein kinase C zeta | 95.76% | 88.48% |
CHEMBL2535 | P11166 | Glucose transporter | 94.96% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.85% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.41% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.09% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.17% | 95.56% |
CHEMBL5747 | Q92793 | CREB-binding protein | 93.05% | 95.12% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.78% | 89.62% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.97% | 99.18% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 90.18% | 90.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.70% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 87.27% | 91.43% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.07% | 91.11% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.14% | 93.31% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.02% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.94% | 90.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.80% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.83% | 94.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.61% | 91.79% |
CHEMBL2581 | P07339 | Cathepsin D | 83.22% | 98.95% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.09% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.64% | 94.45% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.53% | 96.00% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.07% | 95.53% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.67% | 92.38% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 80.58% | 96.47% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.29% | 96.43% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.24% | 91.03% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.11% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boehmeria cylindrica |
Boehmeria dura |
Cissus rheifolia |
Cryptocarya pleurosperma |
PubChem | 92765 |
NPASS | NPC144863 |
ChEMBL | CHEMBL198075 |
LOTUS | LTS0156954 |
wikiData | Q27106253 |