Cryptocapsin
Internal ID | 06de9eba-b653-457c-bc30-5dc688662cea |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | (2E,4E,6E,8E,10E,12E,14E,16E,18E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]-4,8,13,17-tetramethyl-19-(2,6,6-trimethylcyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one |
SMILES (Canonical) | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC(=O)C2(CC(CC2(C)C)O)C)C)C |
SMILES (Isomeric) | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C(=O)[C@@]2(C[C@H](CC2(C)C)O)C)/C)/C |
InChI | InChI=1S/C40H56O2/c1-30(18-13-20-32(3)23-25-36-34(5)22-15-27-38(36,6)7)16-11-12-17-31(2)19-14-21-33(4)24-26-37(42)40(10)29-35(41)28-39(40,8)9/h11-14,16-21,23-26,35,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t35-,40-/m0/s1 |
InChI Key | ITZNDVRDABSNRE-VUWSZMCHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H56O2 |
Molecular Weight | 568.90 g/mol |
Exact Mass | 568.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 11.90 |
7044-42-0 |
SCHEMBL983604 |
CHEBI:176096 |
DTXSID001317913 |
LMPR01070049 |
Q63408946 |
(2E,4E,6E,8E,10E,12E,14E,16E,18E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]-4,8,13,17-tetramethyl-19-(2,6,6-trimethylcyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.69% | 96.09% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 93.24% | 91.67% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.64% | 91.11% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 92.40% | 95.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.74% | 95.50% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 90.62% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.93% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.59% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.02% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.79% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.16% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.33% | 91.07% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.12% | 91.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.83% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.70% | 91.71% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.54% | 89.63% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.52% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 14515709 |
LOTUS | LTS0082698 |
wikiData | Q63408946 |