Crotafuran B
Internal ID | ad24bfb9-09cc-43d5-a348-fe680817a942 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 1-[(1R,12R)-16-hydroxy-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),7,13(18),14,16-heptaen-7-yl]ethanone |
SMILES (Canonical) | CC(=O)C1=CC2=C(O1)C=CC3=C2OC4C3COC5=C4C=CC(=C5)O |
SMILES (Isomeric) | CC(=O)C1=CC2=C(O1)C=CC3=C2O[C@@H]4[C@H]3COC5=C4C=CC(=C5)O |
InChI | InChI=1S/C19H14O5/c1-9(20)16-7-13-15(23-16)5-4-11-14-8-22-17-6-10(21)2-3-12(17)19(14)24-18(11)13/h2-7,14,19,21H,8H2,1H3/t14-,19-/m0/s1 |
InChI Key | RRVLNZLJKIPESL-LIRRHRJNSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H14O5 |
Molecular Weight | 322.30 g/mol |
Exact Mass | 322.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 68.90 Ų |
XlogP | 3.10 |
CHEMBL267742 |
1-(9-Hydroxy-5bbeta,11bbeta-dihydro-6H-3,7,12-trioxabenzo[a]cyclopenta[i]fluorene-2-yl)ethanone |
1-[(1R,12R)-16-Hydroxy-6,11,19-trioxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),7,13(18),14,16-heptaen-7-yl]ethanone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.01% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.81% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.30% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.18% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.66% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.67% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.23% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 87.80% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.79% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.39% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.20% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.50% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.34% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.45% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.93% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crotalaria pallida |
Crotalaria sericea |
PubChem | 10358740 |
NPASS | NPC109180 |
ChEMBL | CHEMBL267742 |
LOTUS | LTS0247884 |
wikiData | Q104667152 |