Coumarsabin
Internal ID | 04b87bea-88c3-4c84-8a74-e53f2ec260dd |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 4,7-dimethoxy-3,5-dimethylchromen-2-one |
SMILES (Canonical) | CC1=CC(=CC2=C1C(=C(C(=O)O2)C)OC)OC |
SMILES (Isomeric) | CC1=CC(=CC2=C1C(=C(C(=O)O2)C)OC)OC |
InChI | InChI=1S/C13H14O4/c1-7-5-9(15-3)6-10-11(7)12(16-4)8(2)13(14)17-10/h5-6H,1-4H3 |
InChI Key | ZMEDOYHRMAKLBS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H14O4 |
Molecular Weight | 234.25 g/mol |
Exact Mass | 234.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 2.30 |
AKOS040734320 |
81421-66-1 |
![2D Structure of Coumarsabin 2D Structure of Coumarsabin](https://plantaedb.com/storage/docs/compounds/2023/11/coumarsabin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.96% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.07% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.44% | 95.56% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.66% | 93.65% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.32% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.88% | 93.31% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.80% | 99.15% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.92% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.47% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.88% | 93.99% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.84% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.62% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus sabina |
Leucas inflata |
PubChem | 86017483 |
LOTUS | LTS0074756 |
wikiData | Q105379387 |