coumaroyl(3-OH)(-6)Glc(b)-O-Ph(2-CH2OH)
Internal ID | 87dc95d3-f55f-465f-a47f-3a20836fa7c0 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(hydroxymethyl)phenoxy]oxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC=C(C(=C1)CO)OC2C(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)O)O)O)O |
SMILES (Isomeric) | C1=CC=C(C(=C1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O)O |
InChI | InChI=1S/C22H24O10/c23-10-13-3-1-2-4-16(13)31-22-21(29)20(28)19(27)17(32-22)11-30-18(26)8-6-12-5-7-14(24)15(25)9-12/h1-9,17,19-25,27-29H,10-11H2/b8-6+/t17-,19-,20+,21-,22-/m1/s1 |
InChI Key | CFMNFEVZASGCCI-CKNMYDPISA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O10 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.34% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.70% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.04% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.64% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.46% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.18% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.61% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 89.47% | 90.71% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.89% | 96.61% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 88.57% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.47% | 95.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.89% | 83.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.29% | 95.93% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.76% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.15% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.96% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.88% | 91.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.04% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 80.18% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alangium chinense |
PubChem | 101702500 |
LOTUS | LTS0062193 |
wikiData | Q104956740 |