Cotarninium
Internal ID | 36839fce-16c0-432f-9fd9-f0ee5de3a851 |
Taxonomy | Organoheterocyclic compounds > Dihydroisoquinolines |
IUPAC Name | 4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
SMILES (Canonical) | C[N+]1=CC2=C(C3=C(C=C2CC1)OCO3)OC |
SMILES (Isomeric) | C[N+]1=CC2=C(C3=C(C=C2CC1)OCO3)OC |
InChI | InChI=1S/C12H14NO3/c1-13-4-3-8-5-10-12(16-7-15-10)11(14-2)9(8)6-13/h5-6H,3-4,7H2,1-2H3/q+1 |
InChI Key | KGZAOSLMBZSSTE-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C12H14NO3+ |
Molecular Weight | 220.24 g/mol |
Exact Mass | 220.09736831 g/mol |
Topological Polar Surface Area (TPSA) | 30.70 Ų |
XlogP | 1.00 |
Cotarninium ion |
Cotarninium cation |
Cotarnine chloride cation |
4SIM4898JC |
20276-45-3 |
UNII-4SIM4898JC |
4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
1,3-Dioxolo(4,5-g)isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl- |
4-methoxy-6-methyl-7,8-dihydro[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
N-Mehtylnorcotarnine |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.84% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.44% | 96.09% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 90.38% | 82.67% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.79% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.60% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.45% | 93.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.70% | 92.62% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 85.50% | 80.96% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.35% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.54% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.51% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.64% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.68% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aucklandia costus |
Papaver orientale |
Papaver somniferum |
PubChem | 160909 |
NPASS | NPC118214 |
LOTUS | LTS0198006 |
wikiData | Q27260433 |