Cosmosporaside E
| Internal ID | a26851a0-fcda-4b97-8ab7-42f361a5ae26 |
| Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
| IUPAC Name | [(2S,3S,4S,5S,6R)-2-[4-acetyloxy-7-hydroxy-3,7,11-trimethyl-1-[(2R,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl]oxydodeca-2,10-dien-6-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (Z)-dec-4-enoate |
| SMILES (Canonical) | CCCCCC=CCCC(=O)OC1C(C(C(OC1OC(CC(C(=CCOC(C(CO)O)C(C(CO)O)O)C)OC(=O)C)C(C)(CCC=C(C)C)O)CO)O)O |
| SMILES (Isomeric) | CCCCC/C=C\CCC(=O)O[C@H]1[C@H]([C@@H]([C@H](O[C@H]1OC(CC(C(=CCO[C@H]([C@@H](CO)O)[C@@H]([C@@H](CO)O)O)C)OC(=O)C)C(C)(CCC=C(C)C)O)CO)O)O |
| InChI | InChI=1S/C39H68O16/c1-7-8-9-10-11-12-13-16-32(46)55-37-35(49)34(48)30(23-42)53-38(37)54-31(39(6,50)18-14-15-24(2)3)20-29(52-26(5)43)25(4)17-19-51-36(28(45)22-41)33(47)27(44)21-40/h11-12,15,17,27-31,33-38,40-42,44-45,47-50H,7-10,13-14,16,18-23H2,1-6H3/b12-11-,25-17?/t27-,28-,29?,30-,31?,33-,34-,35+,36-,37+,38+,39?/m1/s1 |
| InChI Key | BNBIPVQRFYGGRR-NBTUFECBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H68O16 |
| Molecular Weight | 792.90 g/mol |
| Exact Mass | 792.45073608 g/mol |
| Topological Polar Surface Area (TPSA) | 262.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.85% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.49% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.44% | 99.17% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 97.01% | 85.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.38% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.90% | 97.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.72% | 94.73% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.65% | 93.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.48% | 91.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.01% | 92.50% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.48% | 92.08% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.35% | 97.21% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.53% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.42% | 96.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.25% | 98.75% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.00% | 82.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.20% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.10% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.89% | 89.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.06% | 92.88% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.09% | 96.47% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.06% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.90% | 97.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.67% | 91.49% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.49% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.22% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.12% | 91.19% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.66% | 92.86% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.47% | 86.33% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.28% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585456 |
| LOTUS | LTS0101949 |
| wikiData | Q77422871 |