Corynesidone C
| Internal ID | c7430e55-6f6b-4c19-95fa-4bb619f46a11 |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | 3,8,9-trihydroxy-1,7-dimethylbenzo[b][1,4]benzodioxepin-6-one |
| SMILES (Canonical) | CC1=CC(=CC2=C1OC3=C(C(=C(C(=C3)O)O)C)C(=O)O2)O |
| SMILES (Isomeric) | CC1=CC(=CC2=C1OC3=C(C(=C(C(=C3)O)O)C)C(=O)O2)O |
| InChI | InChI=1S/C15H12O6/c1-6-3-8(16)4-11-14(6)20-10-5-9(17)13(18)7(2)12(10)15(19)21-11/h3-5,16-18H,1-2H3 |
| InChI Key | OCRDEHRJPAOPKH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 2.60 |
| 3,8,9-trihydroxy-1,7-dimethylbenzo[b][1,4]benzodioxepin-6-one |
| 3,8,9-trihydroxy-1,7-dimethylbenzo(b)(1,4)benzodioxepin-6-one |
| RefChem:128165 |
| CHEMBL4637771 |
| CHEBI:222084 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.61% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.26% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.74% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.02% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.84% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.19% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.22% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.48% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.07% | 90.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.31% | 93.18% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.89% | 94.80% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.13% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 60154238 |
| LOTUS | LTS0076582 |
| wikiData | Q77570921 |