Corymbolone
Internal ID | 7801efae-2df2-4a31-b4a3-a873a3502c5d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | (4S,4aR,6R,8aR)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
SMILES (Canonical) | CC1CCC(=O)C2(C1(CC(CC2)C(=C)C)O)C |
SMILES (Isomeric) | C[C@H]1CCC(=O)[C@]2([C@]1(C[C@@H](CC2)C(=C)C)O)C |
InChI | InChI=1S/C15H24O2/c1-10(2)12-7-8-14(4)13(16)6-5-11(3)15(14,17)9-12/h11-12,17H,1,5-9H2,2-4H3/t11-,12+,14-,15+/m0/s1 |
InChI Key | BMGSSZITOGSORO-MYZSUADSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O2 |
Molecular Weight | 236.35 g/mol |
Exact Mass | 236.177630004 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 3.00 |
97094-19-4 |
SCHEMBL21093618 |
CHEBI:65659 |
DTXSID40242700 |
Q27134139 |
(4S,4aR,6R,8aR)-4a-hydroxy-4,8a-dimethyl-6-(prop-1-en-2-yl)octahydronaphthalen-1(2H)-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.68% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.51% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.30% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.86% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.81% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.24% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.61% | 85.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.44% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 84.22% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.66% | 93.04% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.09% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.40% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.84% | 91.19% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.55% | 94.75% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.13% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyperus articulatus |
PubChem | 178931 |
LOTUS | LTS0132873 |
wikiData | Q27134139 |