Corossoline
Internal ID | 3be8cf41-5863-4b2f-94d5-ddd65d01214b |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(8R,13R)-8,13-dihydroxy-13-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCC(C1CCC(O1)C(CCCCC(CCCCCCCC2=CC(OC2=O)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC[C@H]([C@H]1CC[C@@H](O1)[C@@H](CCCC[C@@H](CCCCCCCC2=C[C@@H](OC2=O)C)O)O)O |
InChI | InChI=1S/C35H64O6/c1-3-4-5-6-7-8-9-10-14-17-23-31(37)33-25-26-34(41-33)32(38)24-19-18-22-30(36)21-16-13-11-12-15-20-29-27-28(2)40-35(29)39/h27-28,30-34,36-38H,3-26H2,1-2H3/t28-,30+,31+,32+,33+,34+/m0/s1 |
InChI Key | GBNCDYGXXWZSAO-YZDQYAEISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H64O6 |
Molecular Weight | 580.90 g/mol |
Exact Mass | 580.47028976 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 9.90 |
(10R)-Corossoline |
CHEMBL445024 |
CHEBI:176141 |
DTXSID801103766 |
BDBM50004703 |
(2S)-4-[(8R,13R)-8,13-dihydroxy-13-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]tridecyl]-2-methyl-2H-uran-5-one |
(5S)-3-[(8R,13R)-8,13-Dihydroxy-13-[(2R,5R)-tetrahydro-5-[(1R)-1-hydroxytridecyl]-2-furanyl]tridecyl]-5-methyl-2(5H)-furanone |
133352-34-8 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.50% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.48% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.69% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.04% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.07% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.97% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.80% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.15% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.13% | 86.33% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.68% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.97% | 93.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.27% | 83.82% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.82% | 85.94% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.49% | 92.88% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.16% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona muricata |
Goniothalamus leiocarpus |
Rubus alceifolius |
PubChem | 11071966 |
NPASS | NPC131002 |
ChEMBL | CHEMBL445024 |
LOTUS | LTS0121689 |
wikiData | Q105005966 |