Corniculatusin
Internal ID | 49df8b21-4b6a-4546-a6b2-cbe096ff0f7c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-methoxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC(=C(C=C3)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC(=C(C=C3)O)O)O)O |
InChI | InChI=1S/C16H12O8/c1-23-15-10(20)5-9(19)11-12(21)13(22)14(24-16(11)15)6-2-3-7(17)8(18)4-6/h2-5,17-20,22H,1H3 |
InChI Key | ZASFHSAGASJGRN-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C16H12O8 |
Molecular Weight | 332.26 g/mol |
Exact Mass | 332.05321734 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 2.10 |
8-methoxyquercetin |
27500-34-1 |
3,3',4',5,7-Pentahydroxy-8-methoxyflavone |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-methoxy- |
C04527 |
CHEBI:28018 |
DTXSID90181918 |
LMPK12113234 |
Q27103456 |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-methoxy-4H-chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.06% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.01% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.18% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.26% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.09% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.81% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.14% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.57% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.02% | 95.56% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.56% | 98.11% |
CHEMBL3194 | P02766 | Transthyretin | 84.13% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.18% | 99.23% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.89% | 85.30% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.01% | 80.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.34% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lotus corniculatus |
Rhaponticoides africana |
Sedum litoreum |
PubChem | 5280695 |
LOTUS | LTS0195081 |
wikiData | Q27103456 |