Coriandrone E
Internal ID | 0376021e-9660-4d07-a902-27cc172131c3 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 2-benzopyrans |
IUPAC Name | (7S,8R)-8-hydroxy-4-methoxy-7-methyl-7,8-dihydrofuro[2,3-g]isochromen-5-one |
SMILES (Canonical) | CC1C(C2=CC3=C(C=CO3)C(=C2C(=O)O1)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H](C2=CC3=C(C=CO3)C(=C2C(=O)O1)OC)O |
InChI | InChI=1S/C13H12O5/c1-6-11(14)8-5-9-7(3-4-17-9)12(16-2)10(8)13(15)18-6/h3-6,11,14H,1-2H3/t6-,11-/m0/s1 |
InChI Key | FDLXWTAXBWPMFB-KGFZYKRKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H12O5 |
Molecular Weight | 248.23 g/mol |
Exact Mass | 248.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 68.90 Ų |
XlogP | 1.50 |
CHEBI:172489 |
DTXSID301131732 |
(7S,8R)-7,8-Dihydro-8-hydroxy-4-methoxy-7-methyl-5H-furo[2,3-g][2]benzopyran-5-one |
(7S,8R)-8-hydroxy-4-methoxy-7-methyl-7,8-dihydrouro[2,3-g]isochromen-5-one |
177795-34-5 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.65% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.73% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.76% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.55% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.34% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.43% | 86.33% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 89.39% | 94.03% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.12% | 91.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.39% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.27% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.14% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.06% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coriandrum sativum |
PubChem | 101995282 |
LOTUS | LTS0197679 |
wikiData | Q104993643 |