Coralmycin F
| Internal ID | 79443a33-34cd-4eb5-a3f3-f0d371860453 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
| IUPAC Name | 4-[[4-[(4-aminobenzoyl)amino]-3-ethoxy-2-hydroxybenzoyl]amino]-3-ethoxybenzoic acid |
| SMILES (Canonical) | CCOC1=C(C=CC(=C1)C(=O)O)NC(=O)C2=C(C(=C(C=C2)NC(=O)C3=CC=C(C=C3)N)OCC)O |
| SMILES (Isomeric) | CCOC1=C(C=CC(=C1)C(=O)O)NC(=O)C2=C(C(=C(C=C2)NC(=O)C3=CC=C(C=C3)N)OCC)O |
| InChI | InChI=1S/C25H25N3O7/c1-3-34-20-13-15(25(32)33)7-11-18(20)27-24(31)17-10-12-19(22(21(17)29)35-4-2)28-23(30)14-5-8-16(26)9-6-14/h5-13,29H,3-4,26H2,1-2H3,(H,27,31)(H,28,30)(H,32,33) |
| InChI Key | FOXBLCRKNGFLPL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16925015 g/mol |
| Topological Polar Surface Area (TPSA) | 160.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 99.62% | 89.34% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 98.26% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.16% | 87.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.87% | 99.17% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 95.86% | 94.42% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.73% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.61% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.47% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.44% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.18% | 97.21% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 89.08% | 95.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.56% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.51% | 94.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.44% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.85% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.25% | 96.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.75% | 97.36% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.09% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682695 |
| LOTUS | LTS0040150 |
| wikiData | Q104999011 |