Coprismycin B
| Internal ID | 219243e4-bd63-4848-8427-463e8f57bb13 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | (NZ)-N-[(4-methoxy-3-methylsulfanyl-6-phenylpyridin-2-yl)methylidene]hydroxylamine |
| SMILES (Canonical) | COC1=CC(=NC(=C1SC)C=NO)C2=CC=CC=C2 |
| SMILES (Isomeric) | COC1=CC(=NC(=C1SC)/C=N\O)C2=CC=CC=C2 |
| InChI | InChI=1S/C14H14N2O2S/c1-18-13-8-11(10-6-4-3-5-7-10)16-12(9-15-17)14(13)19-2/h3-9,17H,1-2H3/b15-9- |
| InChI Key | ZUUILEHAHVINQF-DHDCSXOGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07759887 g/mol |
| Topological Polar Surface Area (TPSA) | 80.00 Ų |
| XlogP | 3.00 |
| CHEMBL1834087 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.12% | 86.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.60% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.17% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.12% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.71% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.13% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.79% | 91.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.24% | 95.50% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 85.92% | 95.72% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.20% | 99.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.25% | 95.93% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.12% | 90.20% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.69% | 93.04% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.00% | 94.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.33% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solanum abutiloides |
| PubChem | 136099302 |
| LOTUS | LTS0135400 |
| wikiData | Q104991610 |