Coprinacin B
| Internal ID | 426b7e27-93c5-4446-998f-5762536adda9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(3S,5R,7R,10S,11S,13S,14R,16S,17R)-7,11-diacetyloxy-17-[(2S,3S)-3-acetyloxy-6-methylhept-5-en-2-yl]-16-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES (Canonical) | CC(C1C(CC2(C1(CC(C3=C2C(CC4C3(CCC(C4(C)C)OC(=O)C)C)OC(=O)C)OC(=O)C)CO)C)O)C(CC=C(C)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]([C@H]1[C@H](C[C@@]2([C@@]1(C[C@@H](C3=C2[C@@H](C[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)OC(=O)C)OC(=O)C)CO)C)O)[C@H](CC=C(C)C)OC(=O)C |
| InChI | InChI=1S/C38H58O10/c1-20(2)12-13-27(45-22(4)40)21(3)32-26(44)17-37(11)34-28(46-23(5)41)16-30-35(8,9)31(48-25(7)43)14-15-36(30,10)33(34)29(47-24(6)42)18-38(32,37)19-39/h12,21,26-32,39,44H,13-19H2,1-11H3/t21-,26+,27+,28-,29+,30+,31+,32+,36+,37+,38+/m1/s1 |
| InChI Key | APSZJCDRKANCQP-QDDXXPMJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H58O10 |
| Molecular Weight | 674.90 g/mol |
| Exact Mass | 674.40299804 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 4.90 |
| [(3S,5R,7R,10S,11S,13S,14R,16S,17R)-7,11-diacetyloxy-17-[(2S,3S)-3-acetyloxy-6-methylhept-5-en-2-yl]-16-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| ((3S,5R,7R,10S,11S,13S,14R,16S,17R)-7,11-diacetyloxy-17-((2S,3S)-3-acetyloxy-6-methylhept-5-en-2-yl)-16-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta(a)phenanthren-3-yl) acetate |
| RefChem:127917 |
| CHEBI:225787 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.14% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.70% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.31% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.94% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.16% | 85.14% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 89.97% | 92.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.66% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.12% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.35% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.68% | 91.19% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.60% | 91.24% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 87.44% | 99.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.23% | 82.69% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.98% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.95% | 95.50% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.61% | 95.71% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.52% | 90.17% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.44% | 89.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.74% | 91.07% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.39% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.31% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.70% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.85% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.12% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 56964233 |
| LOTUS | LTS0224860 |
| wikiData | Q104916525 |