Conotoxin GI
| Internal ID | 649bc2f1-287c-41a4-9677-1522708af4c0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (4S)-4-amino-5-[[(1R,7S,10S,13S,16S,19R,24R,27S,33S,36S,43R)-27-(2-amino-2-oxoethyl)-19-carbamoyl-7-[3-(diaminomethylideneamino)propyl]-16-(hydroxymethyl)-13-[(3-hydroxyphenyl)methyl]-10-(1H-imidazol-5-ylmethyl)-36-methyl-2,5,8,11,14,17,25,28,34,37,44-undecaoxo-21,22,40,41-tetrathia-3,6,9,12,15,18,26,29,35,38,45-undecazatricyclo[22.14.7.029,33]pentatetracontan-43-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CC1C(=O)NC2CSSCC(C(=O)NC(CSSCC(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC2=O)CCCN=C(N)N)CC3=CN=CN3)CC4=CC(=CC=C4)O)CO)C(=O)N)C(=O)NC(C(=O)N5CCCC5C(=O)N1)CC(=O)N)NC(=O)C(CCC(=O)O)N |
| SMILES (Isomeric) | C[C@H]1C(=O)N[C@H]2CSSC[C@@H](C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC2=O)CCCN=C(N)N)CC3=CN=CN3)CC4=CC(=CC=C4)O)CO)C(=O)N)C(=O)N[C@H](C(=O)N5CCC[C@H]5C(=O)N1)CC(=O)N)NC(=O)[C@H](CCC(=O)O)N |
| InChI | InChI=1S/C55H80N20O18S4/c1-25-44(83)72-36-21-95-97-22-37(73-45(84)29(56)9-10-42(80)81)52(91)74-38(51(90)69-33(16-40(57)78)54(93)75-12-4-8-39(75)53(92)65-25)23-96-94-20-35(43(58)82)71-50(89)34(19-76)70-48(87)31(14-26-5-2-6-28(77)13-26)67-49(88)32(15-27-17-61-24-64-27)68-47(86)30(7-3-11-62-55(59)60)66-41(79)18-63-46(36)85/h2,5-6,13,17,24-25,29-39,76-77H,3-4,7-12,14-16,18-23,56H2,1H3,(H2,57,78)(H2,58,82)(H,61,64)(H,63,85)(H,65,92)(H,66,79)(H,67,88)(H,68,86)(H,69,90)(H,70,87)(H,71,89)(H,72,83)(H,73,84)(H,74,91)(H,80,81)(H4,59,60,62)/t25-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChI Key | CSUQNJQRLCOOSR-NAKBKFBQSA-N |
| Popularity | 57 references in papers |
| Molecular Formula | C55H80N20O18S4 |
| Molecular Weight | 1437.60 g/mol |
| Exact Mass | 1436.48423048 g/mol |
| Topological Polar Surface Area (TPSA) | 725.00 Ų |
| XlogP | -10.10 |
| Atomic LogP (AlogP) | -8.74 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 17 |
| Conotoxin G I |
| Alpha-GI |
| RefChem:127803 |
| (4S)-4-amino-4-(((1R,7S,10S,13S,16S,19R,24R,27S,33S,36S,43R)-7-(3-carbamimidamidopropyl)-19-carbamoyl-27-(carbamoylmethyl)-16-(hydroxymethyl)-13-((3-hydroxyphenyl)methyl)-10-(1H-imidazol-5-ylmethyl)-36-methyl-2,5,8,11,14,17,25,28,34,37,44-undecaoxo-21,22,40,41-tetrathia-3,6,9,12,15,18,26,29,35,38,45-undecaazatricyclo(22.14.7.0^(29,33))pentatetracontan-43-yl)carbamoyl)butanoic acid |
| (4S)-4-amino-5-(((1R,7S,10S,13S,16S,19R,24R,27S,33S,36S,43R)-27-(2-amino-2-oxoethyl)-19-carbamoyl-7-(3-(diaminomethylideneamino)propyl)-16-(hydroxymethyl)-13-((3-hydroxyphenyl)methyl)-10-(1H-imidazol-5-ylmethyl)-36-methyl-2,5,8,11,14,17,25,28,34,37,44-undecaoxo-21,22,40,41-tetrathia-3,6,9,12,15,18,26,29,35,38,45-undecazatricyclo(22.14.7.029,33)pentatetracontan-43-yl)amino)-5-oxopentanoic acid |
| 76862-65-2 |
| Alpha-Conotoxin GI |
| alpha-Conotoxin G I |
| Myotoxin from Conus geographus venom |
| GTPL3983 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6779 | 67.79% |
| Caco-2 | - | 0.8637 | 86.37% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5614 | 56.14% |
| OATP2B1 inhibitior | - | 0.8579 | 85.79% |
| OATP1B1 inhibitior | + | 0.8165 | 81.65% |
| OATP1B3 inhibitior | + | 0.9383 | 93.83% |
| MATE1 inhibitior | - | 0.7809 | 78.09% |
| OCT2 inhibitior | - | 0.5750 | 57.50% |
| BSEP inhibitior | + | 0.9541 | 95.41% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8877 | 88.77% |
| CYP3A4 substrate | + | 0.7511 | 75.11% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8347 | 83.47% |
| CYP3A4 inhibition | - | 0.9405 | 94.05% |
| CYP2C9 inhibition | - | 0.8666 | 86.66% |
| CYP2C19 inhibition | - | 0.8313 | 83.13% |
| CYP2D6 inhibition | - | 0.8881 | 88.81% |
| CYP1A2 inhibition | - | 0.8226 | 82.26% |
| CYP2C8 inhibition | + | 0.8490 | 84.90% |
| CYP inhibitory promiscuity | - | 0.9656 | 96.56% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5633 | 56.33% |
| Eye corrosion | - | 0.9832 | 98.32% |
| Eye irritation | - | 0.8961 | 89.61% |
| Skin irritation | - | 0.7605 | 76.05% |
| Skin corrosion | - | 0.9230 | 92.30% |
| Ames mutagenesis | - | 0.5600 | 56.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6616 | 66.16% |
| Micronuclear | + | 0.9200 | 92.00% |
| Hepatotoxicity | - | 0.5948 | 59.48% |
| skin sensitisation | - | 0.8344 | 83.44% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | + | 0.5364 | 53.64% |
| Acute Oral Toxicity (c) | III | 0.5317 | 53.17% |
| Estrogen receptor binding | + | 0.5623 | 56.23% |
| Androgen receptor binding | + | 0.6326 | 63.26% |
| Thyroid receptor binding | + | 0.6798 | 67.98% |
| Glucocorticoid receptor binding | + | 0.7249 | 72.49% |
| Aromatase binding | + | 0.7662 | 76.62% |
| PPAR gamma | + | 0.6880 | 68.80% |
| Honey bee toxicity | - | 0.6555 | 65.55% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.7437 | 74.37% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.82% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.75% | 99.35% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.72% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.94% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.84% | 93.10% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.83% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.09% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.95% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.82% | 95.93% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.71% | 85.14% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.53% | 97.23% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.50% | 94.64% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 96.44% | 93.03% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 96.03% | 97.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.13% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.91% | 90.71% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.56% | 99.18% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.16% | 97.05% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.01% | 98.75% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.82% | 96.90% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.66% | 99.15% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.56% | 93.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 92.15% | 97.93% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.14% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.99% | 90.08% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 91.70% | 96.11% |
| CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 91.52% | 95.42% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.82% | 90.20% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.52% | 95.58% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.24% | 99.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.77% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.39% | 91.24% |
| CHEMBL4633 | P22001 | Voltage-gated potassium channel subunit Kv1.3 | 88.67% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.48% | 95.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.48% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.14% | 97.14% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.06% | 82.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.44% | 92.88% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.45% | 92.32% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.10% | 93.56% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 82.08% | 99.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.94% | 97.09% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.77% | 95.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.66% | 98.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.40% | 91.19% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.39% | 85.83% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.08% | 94.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 80.91% | 94.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.87% | 88.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25084484 |
| LOTUS | LTS0155763 |
| wikiData | Q27074397 |