Complanatoside B
Internal ID | 25071094-85e4-4f02-ace9-9c1c739a6728 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(=C(C2=O)OC3C(C(C(C(O3)CO)O)O)OC4C(C(CO4)(CO)O)O)C5=CC=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC(=C(C2=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O[C@H]4[C@@H]([C@](CO4)(CO)O)O)C5=CC=C(C=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O |
InChI | InChI=1S/C33H40O20/c1-46-14-6-15(37)19-16(7-14)49-26(12-2-4-13(5-3-12)48-30-25(43)23(41)20(38)17(8-34)50-30)27(22(19)40)52-31-28(24(42)21(39)18(9-35)51-31)53-32-29(44)33(45,10-36)11-47-32/h2-7,17-18,20-21,23-25,28-32,34-39,41-45H,8-11H2,1H3/t17-,18-,20-,21-,23+,24+,25-,28-,29+,30-,31+,32+,33-/m1/s1 |
InChI Key | YCXFPUHHUJNTNY-CUCHOISXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O20 |
Molecular Weight | 756.70 g/mol |
Exact Mass | 756.21129366 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | -2.00 |
142473-99-2 |
3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R)-3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxy-7-methoxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
HY-N7903 |
AKOS040760216 |
3-O-beta-D-apiofuranosyl(1-2)-beta-D-glucopyranosyl rhamnocitrin 4-O-beta-D-glucopyranoside |
MS-31340 |
CS-0138774 |
4H-1-BEnzopyran-4-one, 3-[(2-O-D-apio-|A-D-furanosyl-D-glucopyranosyl)oxy]-2-[4-(|A-D-glucopyranosyloxy)phenyl]-5-hydroxy-7-methoxy- |
![2D Structure of Complanatoside B 2D Structure of Complanatoside B](https://plantaedb.com/storage/docs/compounds/2023/11/complanatoside-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.77% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.72% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.70% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.05% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.66% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.06% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.20% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.34% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.39% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.37% | 95.93% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.86% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.36% | 94.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.09% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.23% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.81% | 99.23% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.81% | 92.94% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.63% | 86.92% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.36% | 95.83% |
CHEMBL220 | P22303 | Acetylcholinesterase | 84.23% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.87% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.20% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.96% | 97.28% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.63% | 95.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.48% | 97.14% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.34% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllolobium chinense |
PubChem | 10440090 |
LOTUS | LTS0187312 |
wikiData | Q105346561 |