Combretastatin A4
| Internal ID | 92e80c5f-cd46-442a-b07d-0b6e833fed58 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H20O5/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h5-11,19H,1-4H3/b6-5- |
| InChI Key | HVXBOLULGPECHP-WAYWQWQTSA-N |
| Popularity | 1,077 references in papers |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 3.70 |
| 117048-59-6 |
| Combretastatin A-4 |
| Combrestatin A4 |
| Combretastatin 4 |
| 2'-deoxycombretastatin A1 |
| NSC-613729 |
| 2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| 16U6OP69RQ |
| 3,4,5-Trimethoxy-3'-hydroxy-4'-methoxystilbene |
| 1-(3,4,5-Trimethoxyphenyl)-2-(3'-hydroxy-4'-methoxyphenyl)ethene |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4302 | P08183 | P-glycoprotein 1 |
6.6 nM 6.6 nM 11.5 nM |
IC50 IC50 IC50 |
PMID: 23895532
via Super-PRED PMID: 23332369 |
| CHEMBL1915 | Q9H4B7 | Tubulin beta-1 chain |
2030 nM 180 nM 1200 nM |
IC50 IC50 IC50 |
PMID: 15293996
PMID: 15658859 PMID: 15943482 |
| CHEMBL2597 | Q13509 | Tubulin beta-3 chain |
5.2 nM 5.7 nM 5.2 nM |
IC50 IC50 IC50 |
via Super-PRED
PMID: 23895532 PMID: 23332369 |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.74% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 94.34% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.83% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.60% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.05% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.97% | 91.49% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.76% | 92.68% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.32% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.25% | 90.20% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.41% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.83% | 89.62% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 82.48% | 83.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.55% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Combretum caffrum |
| Scutellaria baicalensis |