Coleon U 12-methyl ether
| Internal ID | f95b7b09-525d-4ee2-9088-318cf2979731 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 5,8,10-trihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one |
| SMILES (Canonical) | CC(C)C1=C(C2=C(C(=C1OC)O)C3(CCCC(C3=C(C2=O)O)(C)C)C)O |
| SMILES (Isomeric) | CC(C)C1=C(C2=C(C(=C1OC)O)C3(CCCC(C3=C(C2=O)O)(C)C)C)O |
| InChI | InChI=1S/C21H28O5/c1-10(2)11-14(22)12-13(16(24)18(11)26-6)21(5)9-7-8-20(3,4)19(21)17(25)15(12)23/h10,22,24-25H,7-9H2,1-6H3 |
| InChI Key | QWFMIWDUMBELIV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 5.40 |
| NSC647732 |
| 5,8,10-trihydroxy-7-isopropyl-6-methoxy-1,1,4a-trimethyl-3,4-dihydro-2H-phenanthren-9-one |
| (R)-2,3,4,4a-tetrahydro-5,8, 10-trihydroxy-6-methoxy-1,1, 4a-trimethyl-7-(1-methylethyl)-9(1H)-phenanthrenone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.18% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.60% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.33% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.13% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.25% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.90% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.58% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.99% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.13% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.06% | 91.07% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.82% | 99.18% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.45% | 90.71% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.23% | 92.68% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.74% | 91.19% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.62% | 93.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.17% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nepeta ciliaris |
| Nepeta elliptica |
| PubChem | 495262 |
| LOTUS | LTS0081237 |
| wikiData | Q105229139 |