Clusiparalicoline C
| Internal ID | 6aa42f0f-fe39-46bf-8b55-212f25beca0b |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
| IUPAC Name | 7-(4-hydroxyphenyl)-2,2-dimethylchromen-5-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H16O3/c1-17(2)8-7-14-15(19)9-12(10-16(14)20-17)11-3-5-13(18)6-4-11/h3-10,18-19H,1-2H3 |
| InChI Key | KZMOGQPNVGDXEU-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 3.80 |
| Clusiparalicolin C |
| 48MU5QMU8B |
| UNII-48MU5QMU8B |
| 250656-13-4 |
| 7-(4-Hydroxyphenyl)-2,2-dimethyl-2H-1-benzopyran-5-ol |
| 2H-1-Benzopyran-5-ol, 7-(4-hydroxyphenyl)-2,2-dimethyl- |
| CHEMBL446307 |
| 7-(4-hydroxyphenyl)-2,2-dimethylchromen-5-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.79% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.73% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.89% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.70% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.20% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.07% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.94% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.59% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.86% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.01% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.21% | 93.31% |
| CHEMBL1944 | P08473 | Neprilysin | 82.85% | 92.63% |
| CHEMBL4973 | P43004 | Excitatory amino acid transporter 2 | 82.75% | 98.75% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.88% | 80.96% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.27% | 91.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.17% | 94.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.28% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clusia paralicola |
| PubChem | 10084385 |
| LOTUS | LTS0195666 |
| wikiData | Q105148336 |