Clausine D
| Internal ID | cc89151d-f7dd-4dbb-9b8f-cb341cee6dd9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1-hydroxy-4-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H17NO2/c1-11(2)7-8-13-12(10-20)9-16(21)18-17(13)14-5-3-4-6-15(14)19-18/h3-7,9-10,19,21H,8H2,1-2H3 |
| InChI Key | PNBKXALRNLUCJB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 4.40 |
| 142846-95-5 |
| Clausine-D |
| 1-hydroxy-4-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| DTXSID70162200 |
| 9H-Carbazole-3-carboxaldehyde, 1-hydroxy-4-(3-methyl-2-butenyl)- |
| RefChem:126803 |
| DTXCID5084691 |
| 1-HYDROXY-4-(3-METHYLBUT-2-EN-1-YL)-9H-CARBAZOLE-3-CARBALDEHYDE |
| starbld0003107 |
| orb2279349 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.10% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.86% | 91.49% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.55% | 98.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.33% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.41% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.13% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.19% | 91.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.43% | 98.59% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.94% | 97.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.82% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.30% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.91% | 85.14% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.00% | 83.10% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.93% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.28% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena excavata |
| Clausena lansium |
| PubChem | 3035740 |
| NPASS | NPC293151 |
| ChEMBL | CHEMBL2036044 |
| LOTUS | LTS0077051 |
| wikiData | Q72461046 |