Cladosporiumin F
| Internal ID | a4001582-11c2-4bb2-9896-a53a1eca4ddf |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Ketones > Beta-hydroxy ketones |
| IUPAC Name | 3-(3,5-dihydroxyhexanoyl)-4-hydroxy-5-propan-2-ylidenepyrrol-2-one |
| SMILES (Canonical) | CC(CC(CC(=O)C1=C(C(=C(C)C)NC1=O)O)O)O |
| SMILES (Isomeric) | CC(CC(CC(=O)C1=C(C(=C(C)C)NC1=O)O)O)O |
| InChI | InChI=1S/C13H19NO5/c1-6(2)11-12(18)10(13(19)14-11)9(17)5-8(16)4-7(3)15/h7-8,15-16,18H,4-5H2,1-3H3,(H,14,19) |
| InChI Key | GFECIIOJYPXSGC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12632271 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 0.40 |
| CHEBI:189399 |
| 3-(3,5-dihydroxyhexanoyl)-4-hydroxy-5-propan-2-ylidenepyrrol-2-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.26% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.92% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.96% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.88% | 85.14% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.01% | 89.34% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.64% | 83.10% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.67% | 96.47% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.66% | 93.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.15% | 97.25% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.04% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.66% | 98.75% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.56% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.79% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590262 |
| LOTUS | LTS0059005 |
| wikiData | Q104167110 |