Cladosporilactam A
| Internal ID | 9e3dcbda-5183-45e5-a68e-41dfa6833954 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines |
| IUPAC Name | (10aS)-4-methyl-2,3,8,9,10,10a-hexahydropyrrolo[2,1-b][1,3]oxazocin-6-one |
| SMILES (Canonical) | CC1=CC(=O)N2CCCC2OCC1 |
| SMILES (Isomeric) | CC1=CC(=O)N2CCC[C@@H]2OCC1 |
| InChI | InChI=1S/C10H15NO2/c1-8-4-6-13-10-3-2-5-11(10)9(12)7-8/h7,10H,2-6H2,1H3/t10-/m0/s1 |
| InChI Key | NLLHDNJQCBLYET-JTQLQIEISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.64% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.53% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.50% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.24% | 93.40% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 89.45% | 91.76% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.82% | 90.24% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.57% | 94.78% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.38% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.21% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.14% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.60% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.22% | 96.43% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.65% | 92.94% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.62% | 93.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.47% | 86.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.09% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587336 |
| LOTUS | LTS0128905 |
| wikiData | Q77563593 |