Cladoniamide G
| Internal ID | c043efa3-a640-4036-bbac-d9316d93840b |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | (11R)-7,17-dichloro-11-hydroxy-20-methoxy-N-methyl-12-oxo-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4(9),5,7,14(19),15,17-octaene-11-carboxamide |
| SMILES (Canonical) | CNC(=O)C1(C2=C(C3=C(C4=C(N3C1=O)C=CC(=C4)Cl)OC)NC5=C2C=C(C=C5)Cl)O |
| SMILES (Isomeric) | CNC(=O)[C@@]1(C2=C(C3=C(C4=C(N3C1=O)C=CC(=C4)Cl)OC)NC5=C2C=C(C=C5)Cl)O |
| InChI | InChI=1S/C21H15Cl2N3O4/c1-24-19(27)21(29)15-11-7-9(22)3-5-13(11)25-16(15)17-18(30-2)12-8-10(23)4-6-14(12)26(17)20(21)28/h3-8,25,29H,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChI Key | IHIARQAFKOOAQT-OAQYLSRUSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C21H15Cl2N3O4 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.0439614 g/mol |
| Topological Polar Surface Area (TPSA) | 96.40 Ų |
| XlogP | 3.90 |
| CHEBI:65639 |
| (7R)-2,9-dichloro-7-hydroxy-13-methoxy-N-methyl-6-oxo-7,12-dihydro-6H-pyrido[1,2-a:3,4-b']diindole-7-carboxamide |
| (11R)-7,17-dichloro-11-hydroxy-20-methoxy-N-methyl-12-oxo-3,13-diazapentacyclo(11.7.0.02,10.04,9.014,19)icosa-1(20),2(10),4(9),5,7,14(19),15,17-octaene-11-carboxamide |
| (11R)-7,17-dichloro-11-hydroxy-20-methoxy-N-methyl-12-oxo-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4(9),5,7,14(19),15,17-octaene-11-carboxamide |
| (7R)-2,9-dichloro-7-hydroxy-13-methoxy-N-methyl-6-oxo-7,12-dihydro-6H-pyrido(1,2-a:3,4-b')diindole-7-carboxamide |
| RefChem:918773 |
| DTXSID601107736 |
| 1041752-02-6 |
| Q27134109 |
| (7R)-2,9-Dichloro-7,12-dihydro-7-hydroxy-13-methoxy-N-methyl-6-oxo-6H-pyrido[1,2-a:3,4-ba(2)]diindole-7-carboxamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.24% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.30% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.25% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.31% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.22% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.79% | 98.95% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 92.23% | 85.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.13% | 94.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.13% | 86.92% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.16% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.90% | 98.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.77% | 98.59% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.42% | 96.00% |
| CHEMBL2047 | Q96RI1 | Bile acid receptor FXR | 88.93% | 96.10% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.72% | 92.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.60% | 92.88% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.34% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.64% | 92.62% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.32% | 90.24% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.47% | 96.61% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.39% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25053150 |
| LOTUS | LTS0096265 |
| wikiData | Q27134109 |