Citrusinine II
| Internal ID | ce4d0b48-620a-4019-8e5a-5ec23a13f5d2 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,3,5-trihydroxy-4-methoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C=CC=C2O)C(=O)C3=C1C(=C(C=C3O)O)OC |
| SMILES (Isomeric) | CN1C2=C(C=CC=C2O)C(=O)C3=C1C(=C(C=C3O)O)OC |
| InChI | InChI=1S/C15H13NO5/c1-16-12-7(4-3-5-8(12)17)14(20)11-9(18)6-10(19)15(21-2)13(11)16/h3-6,17-19H,1-2H3 |
| InChI Key | QEGXAAUCDUFHPJ-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 90.20 Ų |
| XlogP | 2.60 |
| Citrusinine II |
| CHEMBL465847 |
| 1,3,5-trihydroxy-4-methoxy-10-methylacridone |
| 86680-33-3 |
| GTPL11377 |
| DTXSID201211167 |
| BDBM50336480 |
| compound 5 [PMID: 21277783] |
| 1,3,5-Trihydroxy-4-methoxy-10-methyl-9(10H)-acridinone |
| 1,3,5-TRIHYDROXY-4-METHOXY-10-METHYLACRIDIN-9-ONE |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3272 | O60911 | Cathepsin L2 |
10000 nM |
IC50 |
PMID: 21277783
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.82% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.94% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.22% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.05% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.35% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.61% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.24% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.80% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.45% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.38% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.29% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.87% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.14% | 94.45% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 83.08% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.16% | 94.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.00% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Atalantia buxifolia |
| Citrus × aurantium |
| Swinglea glutinosa |
| PubChem | 10016895 |
| NPASS | NPC2905 |
| ChEMBL | CHEMBL465847 |
| LOTUS | LTS0138333 |
| wikiData | Q104195732 |