Citpressine I
| Internal ID | 65d14772-d99d-436a-a3af-d98c24e85d8a |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C(=CC(=C2)OC)O)C(=O)C3=C1C(=C(C=C3)O)OC |
| SMILES (Isomeric) | CN1C2=C(C(=CC(=C2)OC)O)C(=O)C3=C1C(=C(C=C3)O)OC |
| InChI | InChI=1S/C16H15NO5/c1-17-10-6-8(21-2)7-12(19)13(10)15(20)9-4-5-11(18)16(22-3)14(9)17/h4-7,18-19H,1-3H3 |
| InChI Key | OQMSMWRXIZYYNR-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.90 |
| P3864YU5DK |
| 1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| 81525-58-8 |
| UNII-P3864YU5DK |
| 1,6-Dihydroxy-3,5-dimethoxy-10-methyl-9(10H)-acridinone |
| CHEMBL-455602 |
| 9(10H)-Acridinone, 1,6-dihydroxy-3,5-dimethoxy-10-methyl- |
| 3,5-Dimethoxy-10-methyl-1,6-bis(oxidanyl)acridin-9-one |
| CHEMBL455602 |
| CHEBI:168960 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.73% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.69% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.67% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.15% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.01% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.46% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.42% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.35% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.95% | 90.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.88% | 80.78% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.97% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.43% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.40% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.79% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.90% | 94.42% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.56% | 93.65% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.62% | 92.68% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.55% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.59% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.47% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| Citrus maxima |
| PubChem | 5494827 |
| LOTUS | LTS0071155 |
| wikiData | Q104395922 |